Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Benzene, 1-(bromomethyl)-3-nitro-
1-(Bromomethyl)-3-nitrobenzene · m-(Bromomethyl)nitrobenzene · NSC 66499 · 3-Nitrobromobenzyl · m-NitroBromobenzyl · 3-Nitrobenzyl bromid · M-NITROBENZYL BROMIDE · 3-NITROBENZYL BROMIDE
식별자 및 물리적 특성
| CAS No. | 3958-57-4 |
|---|---|
| 분자식 | C7H6BrNO2 |
| 평균 분자량 | 216.03 g/mol |
| 단동위원소 질량 | 214.95819053 g/mol |
| SMILES | O=[N+]([O-])c1cccc(CBr)c1 |
| InChIKey | LNWXALCHPJANMJ-UHFFFAOYSA-N |
| PubChem CID | 77568 |
| EC No. | 223-557-3 |
| DTXSID | DTXSID4063246 |
화학 및 물리적 성질
| XLogP | 2.7 |
|---|---|
| 극성 표면적 | 45.8 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 146 |
| 물질 분류 | Nitrogen Compounds -> Nitros, Aromatic |
| Physical Description | Light yellow crystalline powder[Alfa Aesar MSDS] |
| 녹는점 | 58-59 °C(lit.) |
| 끓는 점 | 153-154 °C (7 mmHg) |
| 밀도 | 1.6841 (rough estimate) |
| 굴절률 | 1.6120 (estimate) |
| 인화점 | 153-154°C/7mm |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2-8°C |
| 용해도 | 에 용해됨디클로로메탄, 뜨거운 에탄올 |
| 물리적 상태 | 결정질 분말 또는 결정 |
| 색상 | 노란색에서 밝은 갈색까지 |
| 용해도 | 불용성 |
| BRN | 742795 |
| InChI | 1S/C7H6BrNO2/c8-5-6-2-1-3-7(4-6)9(10)11/h1-4H,5H2 |
| InChIKey | LNWXALCHPJANMJ-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cccc(CBr)c1 |
| NIST | Benzene, 1-(bromomethyl)-3-nitro-(3958-57-4) |
| EPA | Benzene, 1-(bromomethyl)-3-nitro- (3958-57-4) |
화학적 성질
Pale Yellow Crystalline Solid
안전 및 규제
| GHS 분류 | DangerH314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P261, P264, P271, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P319, P321, P363, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 유해성 요약 | Causes burns and lachrymationInhalation may cause corrosive injuries to upper respiratory tract and lungs[Alfa Aesar MSDS] See m-Nitrochlorobenzene and alpha-Chloro-m-nitrotoluene. |
| Hazard Classes and Categories | Skin Corr. 1B (100%) |
| 유해 작용 | Dermatotoxin - Skin burns. |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | UN 3261 8/PG 2 |
| 관세 코드 | 29049090 |
| 위험 문구(R) | 34-36/37 |
| 위험 표시 | C |
| 안전 문구(S) | 26-27-28-36/37/39-45 |
| 포장분류 | II |
| 위험 등급 | 8Eye Dam. 1Skin Corr. 1BSTOT SE 3 |
| 저장 분류 | 8A - Combustible corrosive hazardous materials |
용도
용도
3-Nitrobenzyl bromide was used in the synthesis of 1,4-disubstituted imidazoles.