Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-니트로벤질브로마이드
2-니트로벤질브로마이드 · 1-(Bromomethyl)-2-nitrobenzene · 2-Nitrobenzyl · LIXI-011 · 2-Benzyl bromide · o-Nitrobenaylbromide · 2-Nitrobenzyl bromid · -Bromo-2-mitrotoluene
식별자 및 물리적 특성
| CAS No. | 3958-60-9 |
|---|---|
| 분자식 | C7H6BrNO2 |
| 평균 분자량 | 216.03 g/mol |
| 단동위원소 질량 | 214.95819053 g/mol |
| SMILES | O=[N+]([O-])c1ccccc1CBr |
| InChIKey | HXBMIQJOSHZCFX-UHFFFAOYSA-N |
| PubChem CID | 77569 |
| ChEMBL | CHEMBL172430 |
| EC No. | 223-558-9 |
| DTXSID | DTXSID80192699 |
| 현지명 | 2-니트로벤질브로마이드 |
화학 및 물리적 성질
| XLogP | 2.7 |
|---|---|
| 극성 표면적 | 45.8 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 146 |
| 녹는점 | 44-46 °C (lit.) |
| 끓는 점 | 265.51°C (rough estimate) |
| 밀도 | 1.6841 (rough estimate) |
| 굴절률 | 1.6120 (estimate) |
| 인화점 | >230 °F |
| 저장 조건 | Inert atmosphere,2-8°C |
| 용해도 | 클로로포름(약간 용해됨), DMSO(약간 용해됨), 에틸아세테이트(약간 용해됨) |
| 물리적 상태 | 결정 또는 결정성 분말 |
| 색상 | 노란색에서 밝은 갈색까지 |
| 용해도 | 불용성 |
| BRN | 638991 |
| 안정성 | 흡습성 |
| InChI | InChI=1S/C7H6BrNO2/c8-5-6-3-1-2-4-7(6)9(10)11/h1-4H,5H2 |
| InChIKey | HXBMIQJOSHZCFX-UHFFFAOYSA-N |
| SMILES | C1(CBr)=CC=CC=C1[N+]([O-])=O |
| NIST | 2-Nitrobenzyl bromide(3958-60-9) |
화학적 성질
white to light yellow crystal powde
안전 및 규제
| GHS 분류 | DangerH314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P264, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 45 reports by companies from 4 notifications to the ECHA C&L Inventory. |
|---|---|
| 규제 정보 | Benzene, 1-(bromomethyl)-2-nitro-: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Skin Corr. 1B (100%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 3261 8/PG 2 |
| 관세 코드 | 29049085 |
| 위험 문구(R) | 34 |
| 위험 표시 | C |
| 안전 문구(S) | 26-36/37/39-45 |
| 포장분류 | II |
| 위험 등급 | 8Eye Dam. 1Skin Corr. 1B |
| F 고인화성물질 | 4.8-19-21 |
| 저장 분류 | 8A - Combustible corrosive hazardous materials |
용도
용도
2-Nitrobenzyl bromide is used in the preparation of S-2-nitrobenzyl-cysteine by reaction with L-cysteine. It is also used for the introduction of the 2-nitrobenzyl protecting group in organic synthesis. It plays an important role in the production of expectorant agent. Further, it is employed for caging unprotected cysteine-containing or thiophosphorylated peptides in aqueous solution. In addition to this, it is used in the preparation of (R)- and (S)-3-amino-3,4-dihydro-1H-quinolin-2-one.