Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Tris(2-cyanoethyl)phosphine
AURORA KA-1114 · Tri(2-cyanoethyl)phosphine · Tris-(2-cyanoethyl)phophine · Tris(2-cyanoethyl)phosphine · Tris(2-cyanoethyl)phosphine,94% · TCEPTris(2-cyanoethyl)phosphine · TCP Tris(2-cyanoethyl)phosphine · TRIS(2-CYANOETHYL)PHOSPHINE 92+%
식별자 및 물리적 특성
| CAS No. | 4023-53-4 |
|---|---|
| 분자식 | C9H12N3P |
| 평균 분자량 | 193.19 g/mol |
| 단동위원소 질량 | 193.07688439 g/mol |
| SMILES | N#CCCP(CCC#N)CCC#N |
| InChIKey | CHZAMJVESILJGH-UHFFFAOYSA-N |
| PubChem CID | 77639 |
| EC No. | 223-687-0 |
| DTXSID | DTXSID2063268 |
화학 및 물리적 성질
| XLogP | -1 |
|---|---|
| 극성 표면적 | 71.4 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 6 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 223 |
| 녹는점 | 97-98°C |
| 끓는 점 | 235°C 0,9mm |
| 인화점 | 235°C/0.9mm |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2-8°C |
| 물리적 상태 | 수정 같은 |
| 색상 | 하얀색 |
| 용해도 | DMSO 및 DMF에 용해됩니다. 물에 불용성. |
| InChI | InChI=1S/C9H12N3P/c10-4-1-7-13(8-2-5-11)9-3-6-12/h1-3,7-9H2 |
| InChIKey | CHZAMJVESILJGH-UHFFFAOYSA-N |
| SMILES | P(CCC#N)(CCC#N)CCC#N |
| EPA | Propanenitrile, 3,3',3''-phosphinidynetris- (4023-53-4) |
안전 및 규제
| GHS 분류 | DangerH301 (71.4%): Toxic if swallowed [Danger Acute toxicity, oral]P203, P260, P261, P262, P264, P264+P265, P270, P271, P280, P284, P301+P316, P301+P317, P302+P352, P304+P340, P305+P351+P338, P316, P318, P319, P320, P321, P330, P332+P317, P337+P317, P361+P364, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 7 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 3 (71.4%) |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | UN3464 |
| 위험 문구(R) | 20/21/22-36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 36/37/39-45-36-26 |
| 포장분류 | II |
| 위험 등급 | 6.1 |
용도
용도
Tris(2-cyanoethyl)phosphine is used to produce 3,3',3''-phosphanetriyl-tri-propionic acid and hydrochloride by heating. It will need reagent conc. aq. HCl with reaction.