Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-Amino-2-methyl-5-pyrimidinemethanol
Thiamine Impurity 37 · toxopyrimidine · Thiamine Toxopyrimidine · (4-Amino-2-methyl-5-pyrimidinyl) · Thiamine /Vitamin B1 Impurity 20 · 4-AMino-2-Methyl-5-pyriMidineMethanol · 2-Methyl-4-amino-5-pyrimidinemethanol · Thiamine Impurity 15 (Toxopyrimidine)
식별자 및 물리적 특성
| CAS No. | 73-67-6 |
|---|---|
| 분자식 | C6H9N3O |
| 평균 분자량 | 139.16 g/mol |
| 단동위원소 질량 | 139.07456191 g/mol |
| SMILES | Cc1ncc(CO)c(N)n1 |
| InChIKey | VUTBELPREDJDDH-UHFFFAOYSA-N |
| PubChem CID | 777 |
| ChEMBL | CHEMBL1233354 |
| ChEBI | CHEBI:16892 |
| EC No. | 806-933-7 |
| DTXSID | DTXSID80223275 |
화학 및 물리적 성질
| XLogP | -0.1 |
|---|---|
| 극성 표면적 | 72 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 109 |
| 의약품 | Pharmaceuticals -> Listed in ZINC15 |
| 녹는점 | 193-198°mp 198-200° |
| 끓는 점 | 326.0±27.0 °C(Predicted) |
| 밀도 | 1.285±0.06 g/cm3(Predicted) |
| 저장 조건 | Keep in dark place,Inert atmosphere,Room temperature |
| 용해도 | DMSO(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 13.31±0.10(Predicted) |
| 색상 | 흰색에서 황백색까지 |
| Merck | 14,9561 |
| 주요 응용 | 소분자 약용 |
| InChI | InChI=1S/C6H9N3O/c1-4-8-2-5(3-10)6(7)9-4/h2,10H,3H2,1H3,(H2,7,8,9) |
| InChIKey | VUTBELPREDJDDH-UHFFFAOYSA-N |
| SMILES | C1(C)=NC=C(CO)C(N)=N1 |
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 2 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | WGK 3 |
| 관세 코드 | 2933.59.9500 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Toxopyrimidine is intermediate in thiamin biosynthetic pathway, a cofactor crucial for several enzymes involved in carbohydrate and amino acid metabolism.