Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-tert-Butylbenzonitrile
P-TERT-BUTYLBENZONITRILE · 4-(1,1-Dimethylethyl)benzonitrile · P-T-BUTYLBENZONITRILE · 4-t-butylbenzonitrile · 4-TERT-BUTYLCYANOBENZENE · 4-TERT-BUTYLBENZONITRILE · Benzonitrile, p-tert-butyl- · 4-tert-Butylbenzonitrile >4-tert-Butylbenzonitrile 97%
식별자 및 물리적 특성
| CAS No. | 4210-32-6 |
|---|---|
| 분자식 | C11H13N |
| 평균 분자량 | 159.23 g/mol |
| 단동위원소 질량 | 159.10479942 g/mol |
| SMILES | CC(C)(C)c1ccc(C#N)cc1 |
| InChIKey | IIZURLNRIMKEDL-UHFFFAOYSA-N |
| PubChem CID | 77883 |
| EC No. | 224-137-2 |
| DTXSID | DTXSID70194945 |
화학 및 물리적 성질
| XLogP | 3.4 |
|---|---|
| 극성 표면적 | 23.8 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 183 |
| 녹는점 | 12-14 °C |
| 끓는 점 | 258 °C(lit.) |
| 밀도 | 0.94 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.518(lit.) |
| 인화점 | >230 °F |
| 저장 조건 | Sealed in dry,Room Temperature |
| 물리적 상태 | 투명한 액체 |
| 색상 | 무색~연황색 |
| 비중 | 0.95 |
| BRN | 2080049 |
| InChI | InChI=1S/C11H13N/c1-11(2,3)10-6-4-9(8-12)5-7-10/h4-7H,1-3H3 |
| InChIKey | IIZURLNRIMKEDL-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(C(C)(C)C)C=C1 |
| LogP(분배 계수) | 3.49 |
| NIST | 4-t-Butylbenzonitrile(4210-32-6) |
화학적 성질
clear colorless liquid
안전 및 규제
| GHS 분류 | WarningH302 (18.8%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P321, P330, P337+P317, P362+P364, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Status: Active Update: 24-07-2020 https://echa.europa.eu/registration-dossier/-/registered-dossier/10650 |
| Hazard Classes and Categories | Acute Tox. 4 (18.8%) |
| 수질 위해 등급(WGK) | 2 |
| 운송 번호(UN) | 3276 |
| 관세 코드 | 29269090 |
| 위험 문구(R) | 20/21/22 |
| 위험 표시 | Xn,Xi |
| 안전 문구(S) | 36-36/37 |
| 포장분류 | III |
| 위험 등급 | 6.1Acute Tox. 4 Oral |
| 위험 참고 사항 | Irritant |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
4-tert-Butylbenzonitrile may be used to synthesize 3-bromo-4′-tert-butylbenzophenone.
일반 설명
4-tert-Butylbenzonitrile can be prepared from 4-tert-butyl-1,2-dihydrobenzene, via dehydrogenation.