Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-페닐-1,2,4-트리아졸린-3,5-디온
4-페닐-1,2,4-트리아졸린-3,5-디온 · PTAD · 4-Phenyl-1,2,4-triazole-3,5-dione · 4-PHENYL-3 · AURORA KA-3851 · Mosapride Impurity 24 · 4-Phenyl-1,2,3-triazoline-3,5-dione · 4-phenyl-1,2,4-triazole-3,5-quinone
식별자 및 물리적 특성
| CAS No. | 4233-33-4 |
|---|---|
| 분자식 | C8H5N3O2 |
| 평균 분자량 | 175.14 g/mol |
| 단동위원소 질량 | 175.0381764 g/mol |
| SMILES | O=C1N=NC(=O)N1c1ccccc1 |
| InChIKey | ISULLEUFOQSBGY-UHFFFAOYSA-N |
| PubChem CID | 77913 |
| ChEMBL | CHEMBL1354682 |
| EC No. | 224-191-7 |
| DTXSID | DTXSID00195142 |
| 현지명 | 4-페닐-1,2,4-트리아졸린-3,5-디온 |
화학 및 물리적 성질
| XLogP | 1.8 |
|---|---|
| 극성 표면적 | 62.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 251 |
| 용해도 | 11.9 [ug/mL] (The mean of the results at pH 7.4)Chloroform (Sparingly), DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| 녹는점 | 165-170 °C (dec.)(lit.) |
| 끓는 점 | 263.8±23.0 °C(Predicted) |
| 밀도 | 1.47±0.1 g/cm3(Predicted) |
| 저장 조건 | 2-8°C |
| pKa(산도 계수) | -1.71±0.20(Predicted) |
| 물리적 상태 | 고체 |
| 색상 | 빨간색에서 진한 빨간색까지 |
| BRN | 141548 |
| InChI | InChI=1S/C8H5N3O2/c12-7-9-10-8(13)11(7)6-4-2-1-3-5-6/h1-5H |
| InChIKey | ISULLEUFOQSBGY-UHFFFAOYSA-N |
| SMILES | N1C(=O)N(C2=CC=CC=C2)C(=O)N=1 |
화학적 성질
4-PHENYL-1,2,4-TRIAZOLINE-3,5-DIONE is Red Solid
안전 및 규제
| 규제 정보 | 3H-1,2,4-Triazole-3,5(4H)-dione, 4-phenyl-: Does not have an individual approval but may be used under an appropriate group standard |
|---|---|
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29339900 |
| 안전 문구(S) | 22-24/25 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
4-PHENYL-1,2,4-TRIAZOLINE-3,5-DIONE is used in the methods for determining levels of 1,25 dihydroxyvitamin d2 and d3 in biological and food samples and dietary supplements.
일반 설명
4-Phenyl-1,2,4-triazoline-3,5-dione, also known as Cookson reagent, is a strong dienophile, which gives a stable Diels-Alder adduct quantitatively within a short time and under mild conditions. It is commonly used as a protecting group of the diene moiety for the synthesis of vitamin D3 (VD3)-related compounds.