Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4,5-Pyrimidinediamine, 6-chloro-
6-Chloropyrimidine-4,5-diamine · 100063 · NSC 36907 · 4-ChloropyriMidine-5,6-diaMine · 4,5-DiaMino-6-chloropyriMidine · 6-Chloro-4,5-diaminopyrimidine · 6-Chloro-4,5-pyrimidinediamine · 5 6-DIAMINO-4-CHLOROPYRIMIDINE
식별자 및 물리적 특성
| CAS No. | 4316-98-7 |
|---|---|
| 분자식 | C4H5ClN4 |
| 평균 분자량 | 144.56 g/mol |
| 단동위원소 질량 | 144.02027384 g/mol |
| SMILES | Nc1ncnc(Cl)c1N |
| InChIKey | VNSFICAUILKARD-UHFFFAOYSA-N |
| PubChem CID | 78010 |
| EC No. | 224-341-1 |
| DTXSID | DTXSID8063410 |
화학 및 물리적 성질
| XLogP | 0.1 |
|---|---|
| 극성 표면적 | 77.8 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 98.6 |
| 녹는점 | 252 °C (decomp) |
| 끓는 점 | 336.7±37.0 °C(Predicted) |
| 밀도 | 1.565 |
| 인화점 | 157℃ |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2–8 °C |
| 용해도 | DMSO(적게), 메탄올(약간)에 용해됨 |
| 물리적 상태 | powder to crystal |
| pKa(산도 계수) | 2.39±0.10(Predicted) |
| 색상 | White to Amber to Dark green |
| 안정성 | 흡습성 |
| InChI | InChI=1S/C4H5ClN4/c5-3-2(6)4(7)9-1-8-3/h1H,6H2,(H2,7,8,9) |
| InChIKey | VNSFICAUILKARD-UHFFFAOYSA-N |
| SMILES | C1=NC(Cl)=C(N)C(N)=N1 |
| EPA | 4,5-Pyrimidinediamine, 6-chloro- (4316-98-7) |
화학적 성질
Light yellow solid
안전 및 규제
| GHS 분류 | WarningH302 (95%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P272, P280, P301+P317, P302+P352, P305+P351+P338, P321, P330, P333+P317, P337+P317, P362+P364, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (95%) |
| TSCA 등재 상태 | TSCA listed |
| 관세 코드 | 29335990 |
| 위험 문구(R) | 36/37/38 |
| 안전 문구(S) | 26-36 |
용도
용도
4-Amino-6-chloropyrimidin-5-ylamine is a chlorinated diaminopyrimidine used in the preparation of various bioactive choloropurine derivatives.