1,2-Dichloro-1,1,2,2-tetramethyldisilane
1,2-Dichloro-1,1,2,2-tetramethyldisilane · DK785 · DKSI091 · DKFELEX0201 · DICHLOROTETRAMETHYLDISILANE · 1,2-Dichlorotetramethyldisilane · 1,2-Dichlorotetramethyldisilane>1,2-Dichlorotetramethyldisilane 95% · 1,2-DICHLOROTETRAMETHYLDISILANE, 95+%
식별자 및 물리적 특성
| CAS No. | 4342-61-4 |
|---|---|
| 분자식 | C4H12Cl2Si2 |
| 평균 분자량 | 187.21 g/mol |
| 단동위원소 질량 | 185.9854588 g/mol |
| SMILES | C[Si](C)(Cl)[Si](C)(C)Cl |
| InChIKey | SFAZXBAPWCPIER-UHFFFAOYSA-N |
| PubChem CID | 78045 |
| ChEMBL | CHEMBL1905534 |
| EC No. | 224-400-1 |
| DTXSID | DTXSID4040717 |
화학 및 물리적 성질
| 극성 표면적 | 0 |
|---|---|
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 0 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 8 |
| 형식 전하 | 0 |
| 복잡도 | 78 |
| SpringerMaterials Properties | Schoenflies notation |
| 끓는 점 | 148-149 °C(lit.) |
| 밀도 | 1.005 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.454(lit.) |
| 인화점 | 99 °F |
| 저장 조건 | -20°C, sealed storage, away from moisture |
| 물리적 상태 | 액체 |
| 비중 | 1.005 |
| 색상 | 무색 내지 거의 무색 |
| InChI | InChI=1S/C4H12Cl2Si2/c1-7(2,5)8(3,4)6/h1-4H3 |
| InChIKey | SFAZXBAPWCPIER-UHFFFAOYSA-N |
| SMILES | [Si](Cl)(C)(C)[Si](Cl)(C)C |
| EPA | Disilane, 1,2-dichloro-1,1,2,2-tetramethyl- (4342-61-4) |
안전 및 규제
| GHS 분류 | DangerH226 (100%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P260, P264, P280, P301+P330+P331, P302+P361+P354, P303+P361+P353, P304+P340, P305+P354+P338, P316, P321, P363, P370+P378, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 63 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Chemical: Disilane, 1,2-dichloro-1,1,2,2-tetramethyl- |
| Hazard Classes and Categories | Flam. Liq. 3 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | UN 2986 8/PG 2 |
| 관세 코드 | 29319090 |
| 위험 문구(R) | 14-34-10 |
| 위험 표시 | C |
| 안전 문구(S) | 26-27-36/37/39-45 |
| 포장분류 | II |
| 위험 등급 | 8/3Flam. Liq. 3Skin Corr. 1B |
| 저장 분류 | 3 - Flammable liquids |
용도
개요
1,2-DICHLOROTETRAMETHYLDISILANE is a kind of widely used organic silicon intermediates and usually be used as organic silicon blocking agent in the synthesis，such as，Si-Si Compounds; Dichlorosilanes (for Polysilanes); Electroluminescence; Functional Materials; Monochlorosilanes; Reagent for High-Performance Polymer Research; Si (Classes of Silicon Compounds); Si-Cl Compounds; Silicon Compounds (for Synthesis); Synthetic Organic Chemistry; Precursors by Metal; Vapor Deposition Precursors.
용도
1,2-DICHLOROTETRAMETHYLDISILANE is used as an intermediate for preparing other organical compounds. It is also used in aqueous polymer preparation as well as a laboratory reagent. 1,2-Dihydroxy-tetramethyldisilane has been synthesized by hydrolysis of 1,2-dichloro-tetramethyldisilane and characterized by IR, NMR, MS and X-ray structure analysis.