Trimethylsilyl chlorosulphate
trimethylsilyl chlorosulphate · TRIMETHYLSILYLCHLOROSULPHONATE · Trimethylsilyl sulfochloridate · Trimethylsilyl chlorosulfonate · chlorosulfonate de trimethylsilyle · TriMethylsilyl chlorosulfonate 99% · Trimethyl(chlorosulfonyloxy)silane · Chlorosulfonic acid trimethylsilyl ester
식별자 및 물리적 특성
| CAS No. | 4353-77-9 |
|---|---|
| 분자식 | C3H9ClO3SSi |
| 평균 분자량 | 188.71 g/mol |
| 단동위원소 질량 | 187.97301936 g/mol |
| SMILES | C[Si](C)(C)OS(=O)(=O)Cl |
| InChIKey | QWQONZVLXJGXHV-UHFFFAOYSA-N |
| PubChem CID | 78059 |
| EC No. | 224-425-8 |
| DTXSID | DTXSID30195872 |
화학 및 물리적 성질
| 극성 표면적 | 51.8 |
|---|---|
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 174 |
| 녹는점 | −26 °C(lit.) |
| 끓는 점 | 168-169 °C(lit.) |
| 밀도 | 1.225 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.424(lit.) |
| 인화점 | 108 °F |
| 물리적 상태 | 액체 |
| 비중 | 1.23 |
| BRN | 1763675 |
| InChI | InChI=1S/C3H9ClO3SSi/c1-9(2,3)7-8(4,5)6/h1-3H3 |
| InChIKey | QWQONZVLXJGXHV-UHFFFAOYSA-N |
| SMILES | S(Cl)(O[Si](C)(C)C)(=O)=O |
안전 및 규제
| GHS 분류 | DangerH226 (100%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P260, P264, P280, P301+P330+P331, P302+P361+P354, P303+P361+P353, P304+P340, P305+P354+P338, P316, P321, P363, P370+P378, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Flam. Liq. 3 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | No |
| 운송 번호(UN) | UN 2920 8/PG 2 |
| 위험 문구(R) | 10-34 |
| 위험 표시 | C |
| 안전 문구(S) | 26-36/37/39-45 |
| 포장분류 | III |
| 위험 등급 | 3.2Eye Dam. 1Flam. Liq. 3Skin Corr. 1B |
| F 고인화성물질 | 10-21 |
| 저장 분류 | 3 - Flammable liquids |
용도
용도
Trimethylsilyl chlorosulfonate may be used:in the sulfonation of small organic molecules in the synthesis of sulfonated polysulfone as sulfonating agent in the preparation of nano-structured organic-inorganic membranes for proton exchange membrane fuel cells (PEMFC) based on methacrylate and epoxy polymeric structures in the preparation of sulfonated polysulfone (sPS)/titanium dioxide (TiO2) composite membranes for use in PEMFCs in the preparation of iodosobenzene sulfate, required for the synthesis of cyclic sulfates
일반 설명
Trimethylsilyl chlorosulfonate is commonly employed as sulfonating agent.