Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3,4-(Methylenedioxy)phenylacetonitrile
2-(Benzo[d][1,3]dioxol-5-yl)acetonitrile · PIPERONYL CYANIDE · 3,4-METHYLENEDIOXYBENZYL CYANIDE · PEPERACETONITRILE · Homopiperonylnitrile · 1,3-BENZODIOXOLE-5-A · Homopiperonylonitrile · 1,3-BENZODIOXOLE-5-ACETONITRILE
식별자 및 물리적 특성
| CAS No. | 4439-02-5 |
|---|---|
| 분자식 | C9H7NO2 |
| 평균 분자량 | 161.16 g/mol |
| 단동위원소 질량 | 161.04767846 g/mol |
| SMILES | N#CCc1ccc2c(c1)OCO2 |
| InChIKey | ZQPBOYASBNAXOZ-UHFFFAOYSA-N |
| PubChem CID | 78178 |
| EC No. | 224-655-9 |
| DTXSID | DTXSID50196149 |
화학 및 물리적 성질
| XLogP | 1.6 |
|---|---|
| 극성 표면적 | 42.3 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 208 |
| 물질 분류 | Nitrogen Compounds -> Nitriles |
| Physical Description | Faintly beige powder[MSDSonline] |
| 녹는점 | 43-45 °C(lit.) |
| 끓는 점 | 135-140°C 5mm |
| 밀도 | 1.270±0.06 g/cm3(Predicted) |
| 인화점 | >230 °F |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 물리적 상태 | powder to crystal |
| 색상 | 흰색에서 밝은 노란색 |
| 용해도 | 물에 불용성. |
| BRN | 7739 |
| InChI | InChI=1S/C9H7NO2/c10-4-3-7-1-2-8-9(5-7)12-6-11-8/h1-2,5H,3,6H2 |
| InChIKey | ZQPBOYASBNAXOZ-UHFFFAOYSA-N |
| SMILES | O1C2=CC=C(CC#N)C=C2OC1 |
| NIST | 3,4-Methylenedioxyphenylacetonitrile(4439-02-5) |
화학적 성질
Pale yellow low melting solid
안전 및 규제
| GHS 분류 | WarningH302 (98%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P270, P271, P280, P301+P317, P302+P352, P304+P340, P317, P321, P330, P362+P364, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 49 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 유해성 요약 | May cause irritation[MSDSonline] See NITRILES. |
| Hazard Classes and Categories | Acute Tox. 4 (98%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | 3439 |
| 관세 코드 | 29329990 |
| 위험 문구(R) | 20/21/22 |
| 위험 표시 | Xn |
| 안전 문구(S) | 36-36/37 |
| 포장분류 | III |
| 위험 등급 | 6.1Acute Tox. 4 DermalAcute Tox. 4 InhalationAcute Tox. 4 Oral |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
3,4-(Methylenedioxy)phenylacetonitrile was used in synthesis of derrubone. It was used as standard to analyze the seized methamphetamine samples showing unique profiles of stable isotopic compositions by isotope ratio mass spectrometry.
일반 설명
3,4-(Methylenedioxy)phenylacetonitrile undergoes hydrolysis catalyzed by nitrilase ZmNIT2 enzyme from maize.