Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Methylethyldichlorosilane
DK305 · CID 53428249 · dichloroethylmethyl-silan · DICHLOROETHYLMETHYLSILANE · ETHYLMETHYLDICHLOROSILANE · Methylethyldichlorosilane · ethyldichloromethylsilane · Silane, dichloroethylmethyl-
식별자 및 물리적 특성
| CAS No. | 4525-44-4 |
|---|---|
| 분자식 | C3H8Cl2Si |
| 평균 분자량 | 143.08 g/mol |
| 단동위원소 질량 | 141.9772322 g/mol |
| SMILES | CC[Si](C)(Cl)Cl |
| InChIKey | PNECSTWRDNQOLT-UHFFFAOYSA-N |
| PubChem CID | 78286 |
| EC No. | 224-860-3 |
| DTXSID | DTXSID50871085 |
화학 및 물리적 성질
| 극성 표면적 | 0 |
|---|---|
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 0 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 6 |
| 형식 전하 | 0 |
| 복잡도 | 44.1 |
| SpringerMaterials Properties | 29Si nuclear magnetic resonance spectrum |
| 녹는점 | 8°C |
| 끓는 점 | 100 °C(lit.) |
| 밀도 | 1.063 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.419(lit.) |
| 인화점 | 54 °F |
| 비중 | 1.063 |
| BRN | 1361374 |
| InChI | InChI=1S/C3H8Cl2Si/c1-6-2-3(4)5/h3H,2,6H2,1H3 |
| InChIKey | BYKDIAHBFKIHHS-UHFFFAOYSA-N |
| SMILES | [SiH2](CC(Cl)Cl)C |
| EPA | Silane, dichloroethylmethyl- (4525-44-4) |
안전 및 규제
| GHS 분류 | DangerH225 (100%): Highly Flammable liquid and vapor [Danger Flammable liquids]P210, P233, P240, P241, P242, P243, P260, P264, P280, P301+P330+P331, P302+P361+P354, P303+P361+P353, P304+P340, P305+P354+P338, P316, P321, P363, P370+P378, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 58 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Chemical: Silane, dichloroethylmethyl-Silane, dichloroethylmethyl-: Does not have an individual approval but may be used as a component in a product covered by a group standard. It is not approved for use as a chemical in its own right. |
| Hazard Classes and Categories | Flam. Liq. 2 (100%) |
| 수질 위해 등급(WGK) | 1 |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | UN 2985 3/PG 2 |
| 관세 코드 | 29319090 |
| 위험 문구(R) | 11-34 |
| 위험 표시 | F,C |
| 안전 문구(S) | 16-26-28-36/37/39-45 |
| 포장분류 | II |
| 위험 등급 | 3Eye Dam. 1Flam. Liq. 2Skin Corr. 1B |
| F 고인화성물질 | 10-21 |
| 저장 분류 | 3 - Flammable liquids |
용도
용도
Ethylmethyldichlorosilane is the raw material for producing silicone rubber and silicone resin. Silicone resins has many advantages over natural rubber.