Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-Chloro-5-nitropyridine
Chloro-5-nitropyrid · Chloronitropyridine · Piroctone Impurity 3 · 3-PYRIDINOL, 6-CHLORO- · 2-Chlor-5-nitropyridin · 2-choro-5-nitropyridine · Chloronitropyridine,99% · 2-Chloro--nitropyridine
식별자 및 물리적 특성
| CAS No. | 4548-45-2 |
|---|---|
| 분자식 | C5H3ClN2O2 |
| 평균 분자량 | 158.54 g/mol |
| 단동위원소 질량 | 157.98830502 g/mol |
| SMILES | O=[N+]([O-])c1ccc(Cl)nc1 |
| InChIKey | BAZVFQBTJPBRTJ-UHFFFAOYSA-N |
| PubChem CID | 78308 |
| EC No. | 224-908-3 |
| DTXSID | DTXSID70196525 |
화학 및 물리적 성질
| XLogP | 2.2 |
|---|---|
| 극성 표면적 | 58.7 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 136 |
| SpringerMaterials Properties | Nuclear quadrupole resonance spectroscopy |
| 녹는점 | 105-108 °C (lit.) |
| 끓는 점 | 256.6±20.0 °C(Predicted) |
| 밀도 | 1.6616 (rough estimate) |
| 굴절률 | 1.5500 (estimate) |
| 인화점 | 158°C |
| 저장 조건 | Keep in dark place,Sealed in dry,Room Temperature |
| pKa(산도 계수) | -4.22±0.10(Predicted) |
| 물리적 상태 | 결정성 분말 |
| 색상 | 밝은 노란색에서 베이지색까지 |
| 용해도 | 뜨거운 메탄올에 대한 용해도. 물에 불용성. |
| BRN | 120453 |
| InChI | InChI=1S/C5H3ClN2O2/c6-5-2-1-4(3-7-5)8(9)10/h1-3H |
| InChIKey | BAZVFQBTJPBRTJ-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C([N+]([O-])=O)C=C1 |
| NIST | 2-Chloro-5-nitropyridine(4548-45-2) |
화학적 성질
white to light yellow crystal
안전 및 규제
| GHS 분류 | WarningH302 (14%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 50 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Pyridine, 2-chloro-5-nitro-: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Acute Tox. 4 (14%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | US7175000 |
| 관세 코드 | 29333990 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36-37/39 |
| 위험 등급 | IRRITANTEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 기존화학 물질 | KE-05792 |
| 저장 분류 | 11 - Combustible Solids |
용도
개요
2-Chloro-5-nitropyridine is an important intermediate in the synthesis of many drugs, such as the antimalarial drug pyronaridine.
용도
2-Chloro-5-nitropyridine is used as a pharmaceutical intermediate.
용도
2-chloro-5-nitropyridine is an important pyridine derivative and is an intermediate for synthesizing bactericides, plant growth regulators, antibiotics and other medicaments.