Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Methyl 2-amino-3-thenoate
METHYL 2-AMINO-3-THIOPHENECARBOXYLATE · AKOS 90546 · METHYL 2-A · AKOS B014692 · BUTTPARK 46\18-81 · ART-CHEM-BB B014692 · Methyl-2-amino-3-thenoat · methyl 2-amino-3-thenoate
식별자 및 물리적 특성
| CAS No. | 4651-81-4 |
|---|---|
| 분자식 | C6H7NO2S |
| 평균 분자량 | 157.19 g/mol |
| 단동위원소 질량 | 157.01974946 g/mol |
| SMILES | COC(=O)c1ccsc1N |
| InChIKey | DGGJQLCAYQCPDD-UHFFFAOYSA-N |
| PubChem CID | 78381 |
| ChEBI | CHEBI:194919 |
| EC No. | 225-084-8 |
| DTXSID | DTXSID70196863 |
화학 및 물리적 성질
| XLogP | 1.7 |
|---|---|
| 극성 표면적 | 80.6 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 140 |
| 녹는점 | 76-81 °C (lit.) |
| 끓는 점 | 259.5±20.0 °C(Predicted) |
| 밀도 | 1.319±0.06 g/cm3(Predicted) |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2–8 °C |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 0.10±0.10(Predicted) |
| 색상 | 베이지색 |
| InChI | InChI=1S/C6H7NO2S/c1-9-6(8)4-2-3-10-5(4)7/h2-3H,7H2,1H3 |
| InChIKey | DGGJQLCAYQCPDD-UHFFFAOYSA-N |
| SMILES | C1(N)SC=CC=1C(OC)=O |
화학적 성질
white to light yellow crystal powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 43 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29349990 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36 |
| 위험 등급 | IRRITANTEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Methyl 2-aminothiophene-3-carboxylate may be used to prepare 3-thiaisatoic anhydride via hydrolysis, followed by the reaction with phosgene.