Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1-Benzylpiperidin-4-ol
N-BENZYL-4-PIPERIDINOL · 1-BENZYL-4-PIPERIDINOL · 1-Benzyl-piperidin-4-ol · NSC 72991 · Compound Fr12729 · benzyl-4-piperidinol · LABOTEST-BB LT00159455 · Revefenacin Impurity 33
식별자 및 물리적 특성
| CAS No. | 4727-72-4 |
|---|---|
| 분자식 | C12H17NO |
| 평균 분자량 | 191.27 g/mol |
| 단동위원소 질량 | 191.13101416 g/mol |
| SMILES | OC1CCN(Cc2ccccc2)CC1 |
| InChIKey | BPPZXJZYCOETDA-UHFFFAOYSA-N |
| PubChem CID | 78461 |
| ChEMBL | CHEMBL4796237 |
| EC No. | 225-226-9 |
| DTXSID | DTXSID80197083 |
화학 및 물리적 성질
| XLogP | 1.3 |
|---|---|
| 극성 표면적 | 23.5 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 158 |
| 녹는점 | 61-63 °C(lit.) |
| 끓는 점 | 127-128 °C2 mm Hg(lit.) |
| 밀도 | 1.0096 (rough estimate) |
| 굴절률 | 1.5212 (estimate) |
| 인화점 | 121-123°C/0.7mm |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 용해도 | 클로로포름, 메탄올에 용해됨 |
| pKa(산도 계수) | 14.87±0.20(Predicted) |
| 물리적 상태 | 결정성 분말 |
| 색상 | 흰색에서 노란색으로 |
| BRN | 146118 |
| InChI | InChI=1S/C12H17NO/c14-12-6-8-13(9-7-12)10-11-4-2-1-3-5-11/h1-5,12,14H,6-10H2 |
| InChIKey | BPPZXJZYCOETDA-UHFFFAOYSA-N |
| SMILES | N1(CC2=CC=CC=C2)CCC(O)CC1 |
| NIST | 4-Piperidinol, 1-(phenylmethyl)-(4727-72-4) |
화학적 성질
WHITE TO YELLOWISH CRYSTALLINE POWDER
안전 및 규제
| GHS 분류 | DangerH301 (81.2%): Toxic if swallowed [Danger Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P316, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 3 (81.2%) |
| 수질 위해 등급(WGK) | 2 |
| 운송 번호(UN) | UN 2811 6.1/PG 3 |
| 관세 코드 | 29333990 |
| 위험 문구(R) | 25-36/37/38-20/21/22 |
| 위험 표시 | T,C,Xi,Xn |
| 안전 문구(S) | 26-45-37/39-36 |
| 위험 등급 | Acute Tox. 3 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
용도
용도
1-Benzyl-4-hydroxypiperidine is the reactant for synthesis of: Muscarinic acetylcholine receptor antagonist and beta 2 adrenoceptor agonist1 Fatty acid amide hydrolase inhibitors PI3 kinase-alpha inhibitors Flavonoid derivatives used as dual binding acetylcholinesterase inhibitors Urotensin-II receptor antagonists Rho kinase inhibitors.