Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-피페리디노피페리딘
4-피페리디노피페리딘 · 1,4'-Bipiperidine · 1-Piperidin-4-ylpiperidine · AKOS BB-9180 · 1,4'-bipiperidyl · 4-Piperidinopiperid · [1,4']BIPIPERIDINYL · 3-Boc-aminopiperidin
식별자 및 물리적 특성
| CAS No. | 4897-50-1 |
|---|---|
| 분자식 | C10H20N2 |
| 평균 분자량 | 168.28 g/mol |
| 단동위원소 질량 | 168.16264864 g/mol |
| SMILES | C1CCN(C2CCNCC2)CC1 |
| InChIKey | QDVBKXJMLILLLB-UHFFFAOYSA-N |
| PubChem CID | 78607 |
| ChEMBL | CHEMBL174391 |
| ChEBI | CHEBI:40117 |
| EC No. | 225-522-8 |
| DTXSID | DTXSID20197648 |
| 현지명 | 4-피페리디노피페리딘 |
화학 및 물리적 성질
| XLogP | 1.2 |
|---|---|
| 극성 표면적 | 15.3 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 124 |
| 의약품 | Pharmaceuticals -> Listed in ZINC15 |
| 녹는점 | 64-66 °C (lit.) |
| 끓는 점 | 287.25°C (rough estimate) |
| 밀도 | 0.9725 (rough estimate) |
| 굴절률 | 1.6011 (estimate) |
| 저장 조건 | -20°C |
| 용해도 | 클로로포름(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 결정질 고체 |
| pKa(산도 계수) | 10.31±0.10(Predicted) |
| 색상 | 연한 노란색에서 황갈색 |
| InChI | InChI=1S/C10H20N2/c1-2-8-12(9-3-1)10-4-6-11-7-5-10/h10-11H,1-9H2 |
| InChIKey | QDVBKXJMLILLLB-UHFFFAOYSA-N |
| SMILES | N1(C2CCNCC2)CCCCC1 |
화학적 성질
light yellow to yellow-brown crystalline solid
안전 및 규제
| GHS 분류 | DangerH314 (11.5%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P261, P264, P264+P265, P271, P280, P301+P330+P331, P302+P352, P302+P361+P354, P304+P340, P305+P351+P338, P305+P354+P338, P316, P319, P321, P332+P317, P337+P317, P362+P364, P363, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 52 reports by companies from 10 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Corr. 1B (11.5%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29339900 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36-24/25 |
| 위험 등급 | 8Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Reactant for synthesis of: Arylthiadiazole H3 antagonists1 Water-soluble N-mustards as anticancer agents2 Antitubercular drugs3 Vasopressin1b receptor antagonists4 MDR modulators5 Selective Norepinephrine transporter inhibitors6