Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1-메톡시-4-니트로나프탈렌
1-메톡시-4-니트로나프탈렌 · methyl4-nitronaphthylether · 1-Methoxy-4-nitronaphthalin · 4-Methoxy-1-nitronaphthalene · 1-METHOXY-4-NITRONAPHTHALENE · 1-Nitro-4-methoxynaphthalene · Naphthalene,1-methoxy-4-nitro- · 1-Methoxy-4-nitronaphthalene 99%
식별자 및 물리적 특성
| CAS No. | 4900-63-4 |
|---|---|
| 분자식 | C11H9NO3 |
| 평균 분자량 | 203.19 g/mol |
| 단동위원소 질량 | 203.05824315 g/mol |
| SMILES | COc1ccc([N+](=O)[O-])c2ccccc12 |
| InChIKey | YFJKGPRYPHFGQD-UHFFFAOYSA-N |
| PubChem CID | 78613 |
| EC No. | 225-528-0 |
| DTXSID | DTXSID20197663 |
| 현지명 | 1-메톡시-4-니트로나프탈렌 |
화학 및 물리적 성질
| XLogP | 2.7 |
|---|---|
| 극성 표면적 | 55.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 15 |
| 형식 전하 | 0 |
| 복잡도 | 238 |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| 녹는점 | 83-85 °C (lit.) |
| 끓는 점 | 341.49°C (rough estimate) |
| 밀도 | 1.2621 (rough estimate) |
| 굴절률 | 1.4950 (estimate) |
| 저장 조건 | Sealed in dry,Room Temperature |
| InChI | InChI=1S/C11H9NO3/c1-15-11-7-6-10(12(13)14)8-4-2-3-5-9(8)11/h2-7H,1H3 |
| InChIKey | YFJKGPRYPHFGQD-UHFFFAOYSA-N |
| SMILES | C1(OC)=C2C(C=CC=C2)=C([N+]([O-])=O)C=C1 |
화학적 성질
yellow to orange crystalline powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-37/39 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
1-Methoxy-4-nitronaphthalene is used as a reagent in the synthesis of UMI-77 (U700850); a small molecule inhibitor of Mcl-1 which blocks and attenuates pancreatic cell cancer growth. Also an anticancer agent.