Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4'-브로모부티로페논
4'-브로모부티로페논 · NSC76558 · NSC 76558 · ST5207857 · AURORA 22533 · ZINC00065218 · EINECS 225-632-6 · 4-BROMOBUTYROPHENONE
식별자 및 물리적 특성
| CAS No. | 4981-64-0 |
|---|---|
| 분자식 | C10H11BrO |
| 평균 분자량 | 227.1 g/mol |
| 단동위원소 질량 | 225.99932707 g/mol |
| SMILES | CCCC(=O)c1ccc(Br)cc1 |
| InChIKey | HOIDKJFWEVIJAT-UHFFFAOYSA-N |
| PubChem CID | 78680 |
| EC No. | 225-632-6 |
| DTXSID | DTXSID9063663 |
| 현지명 | 4'-브로모부티로페논 |
화학 및 물리적 성질
| XLogP | 3.3 |
|---|---|
| 극성 표면적 | 17.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 148 |
| 녹는점 | 38-39 °C(Solv: ligroine (8032-32-4)) |
| 끓는 점 | 149-151 °C(Press: 13 Torr) |
| 밀도 | 1.334±0.06 g/cm3(Predicted) |
| 저장 조건 | Sealed in dry,Room Temperature |
| InChI | InChI=1S/C10H11BrO/c1-2-3-10(12)8-4-6-9(11)7-5-8/h4-7H,2-3H2,1H3 |
| InChIKey | HOIDKJFWEVIJAT-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(Br)C=C1)(=O)CCC |
| NIST | 1-(4-Bromophenyl)-1-butanone(4981-64-0) |
| EPA | 1-Butanone, 1-(4-bromophenyl)- (4981-64-0) |
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P301+P317, P330, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 1 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| TSCA 등재 상태 | TSCA listed |
용도
용도
4'-Bromobutyrophenone is used in organic synthesis. It reacts with triphenylphosphine to form tetraphenylphosphonium bromide.