Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
HCID 78864생성일: 2026년 10월 23일
4-클로로-퀴나졸린
4-클로로-퀴나졸린 · AKOS BBS-00004561 · 4-Chloro-quizoline · 4-Chloroquinozoline · 4-CHLORO-QUINAZOLINE · Quinazoline, 4-chloro- · 4-Chloroquinazoline 97%
https://huagongshe.com/ko/chemical/78864
식별자 및 물리적 특성
| CAS No. | 5190-68-1 |
|---|
| 분자식 | C8H5ClN2 |
|---|
| 평균 분자량 | 164.59 g/mol |
|---|
| 단동위원소 질량 | 164.01412584 g/mol |
|---|
| SMILES | Clc1ncnc2ccccc12 |
|---|
| InChIKey | GVRRXASZZAKBMN-UHFFFAOYSA-N |
|---|
| PubChem CID | 78864 |
|---|
| ChEMBL | CHEMBL2172707 |
|---|
| EC No. | 625-876-7 |
|---|
| DTXSID | DTXSID40199866 |
|---|
| 현지명 | 4-클로로-퀴나졸린 |
|---|
화학 및 물리적 성질
| XLogP | 1.9 |
|---|
| 극성 표면적 | 25.8 |
|---|
| 수소 결합 공여자 수 | 0 |
|---|
| 수소 결합 수용자 수 | 2 |
|---|
| 회전 가능 결합 수 | 0 |
|---|
| 무거운 원자 수 | 11 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 140 |
|---|
| 녹는점 | 96-100 °C |
|---|
| 끓는 점 | 281.0±13.0 °C(Predicted) |
|---|
| 밀도 | 1.349±0.06 g/cm3(Predicted) |
|---|
| 저장 조건 | under inert gas (nitrogen or Argon) at 2-8°C |
|---|
| 용해도 | 메탄올에 용해됨 |
|---|
| 물리적 상태 | 고체 |
|---|
| pKa(산도 계수) | 0.83±0.30(Predicted) |
|---|
| 색상 | 회백색 |
|---|
| InChI | InChI=1S/C8H5ClN2/c9-8-6-3-1-2-4-7(6)10-5-11-8/h1-5H |
|---|
| InChIKey | GVRRXASZZAKBMN-UHFFFAOYSA-N |
|---|
| SMILES | N1=C2C(C=CC=C2)=C(Cl)N=C1 |
|---|
안전 및 규제
| GHS 분류 | DangerH301 (100%): Toxic if swallowed [Danger Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P316, P302+P352, P304+P340, P305+P354+P338, P317, P319, P321, P330, P332+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 41 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Acute Tox. 3 (100%) |
|---|
| 수질 위해 등급(WGK) | 3 |
|---|
| 운송 번호(UN) | UN 2811 |
|---|
| 관세 코드 | 2933998090 |
|---|
| 위험 문구(R) | 25-37/38-41 |
|---|
| 위험 표시 | Xi,T |
|---|
| 안전 문구(S) | 26-39-45 |
|---|
| 위험 등급 | IRRITANTAcute Tox. 3 OralEye Dam. 1Skin Irrit. 2STOT SE 3 |
|---|
| 저장 분류 | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
|---|
