Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-니트로-3-클로로톨루엔
2-니트로-3-클로로톨루엔 · 1-Chloro-3-methyl-2-nitrobenzene · 3-Chloro-2-nitrotoluene · Toluene, 3- · 2-Nitro-3-chlorotolu · 3-Chlor-2-nitrotoluol · 2-Nitro-3-chlorotoluene · 2-NOITRO-3-CHLORO TOLUENE
식별자 및 물리적 특성
| CAS No. | 5367-26-0 |
|---|---|
| 분자식 | C7H6ClNO2 |
| 평균 분자량 | 171.58 g/mol |
| 단동위원소 질량 | 171.00870611 g/mol |
| SMILES | Cc1cccc(Cl)c1[N+](=O)[O-] |
| InChIKey | JLDKNVUJLUGIBQ-UHFFFAOYSA-N |
| PubChem CID | 79328 |
| EC No. | 226-354-8 |
| DTXSID | DTXSID20201911 |
| 현지명 | 2-니트로-3-클로로톨루엔 |
화학 및 물리적 성질
| XLogP | 2.7 |
|---|---|
| 극성 표면적 | 45.8 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 157 |
| 녹는점 | 22-23 °C |
| 끓는 점 | 80°C/2mmHg(lit.) |
| 밀도 | 1.324±0.06 g/cm3(Predicted) |
| 굴절률 | 1.5370 to 1.5410 |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 물리적 상태 | powder to lump to clear liquid |
| 색상 | White or Colorless to Yellow |
화학적 성질
Yellow oily liquid
안전 및 규제
| GHS 분류 | DangerH301 (100%): Toxic if swallowed [Danger Acute toxicity, oral]P264, P264+P265, P270, P280, P301+P316, P302+P352, P305+P351+P338, P321, P330, P332+P317, P337+P317, P362+P364, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 3 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 3 (100%) |
| 운송 번호(UN) | UN 2433 6.1/PG III |
| 관세 코드 | 2904990090 |
| 포장분류 | III |
| 위험 등급 | 6.1 |