Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2,5-Dichlorobenzenesulfonyl chloride
2,5-Dichlorobenzene-1-sulfonyl chloride · 2,5-dichloro-benzenesulfonylchlorid · 2,5-Dichlorobenzenesulfonyl chloride · 2,5-DICHLOROBENZENESULPHONYL CHLORIDE · 2,5-DichlorobenzenesulfonylChloride>Benzenesulfonyl chloride, 2,5-dichloro- · 2,5-Dichlorobenzenesulphonyl chloride 98% · 2,5-DICHLOROBENZENESULFONYL CHLORIDE, 98 % · 2,5-Dichlorobenzenesulfonyl chloride, 98% 25GR
식별자 및 물리적 특성
| CAS No. | 5402-73-3 |
|---|---|
| 분자식 | C6H3Cl3O2S |
| 평균 분자량 | 245.5 g/mol |
| 단동위원소 질량 | 243.89193338 g/mol |
| SMILES | O=S(=O)(Cl)c1cc(Cl)ccc1Cl |
| InChIKey | BXCOSWRSIISQSL-UHFFFAOYSA-N |
| PubChem CID | 79401 |
| EC No. | 226-453-6 |
| DTXSID | DTXSID7063841 |
화학 및 물리적 성질
| XLogP | 3 |
|---|---|
| 극성 표면적 | 42.5 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 246 |
| 물질 분류 | Toxic Gases & Vapors -> Acid Halides |
| SpringerMaterials Properties | Nuclear quadrupole resonance spectroscopy |
| Physical Description | Off-white powdermp = 36-37 deg C[Alfa Aesar MSDS] |
| 녹는점 | 36-37 °C(lit.) |
| 끓는 점 | 253°C (estimate) |
| 밀도 | 1.608 (estimate) |
| 인화점 | >230 °F |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 용해도 | 클로로포름, DMSO 에 용해됨 |
| 물리적 상태 | 고체 |
| 색상 | 미색부터 페일 베이지까지 |
| BRN | 2369410 |
| InChI | 1S/C6H3Cl3O2S/c7-4-1-2-5(8)6(3-4)12(9,10)11/h1-3H |
| InChIKey | BXCOSWRSIISQSL-UHFFFAOYSA-N |
| SMILES | Clc1ccc(Cl)c(c1)S(Cl)(=O)=O |
| EPA | Benzenesulfonyl chloride, 2,5-dichloro- (5402-73-3) |
화학적 성질
beige crystalline powder
안전 및 규제
| GHS 분류 | DangerH314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P261, P264, P264+P265, P271, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P317, P319, P321, P363, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 47 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 유해성 요약 | Causes burnsInhalation may cause corrosive injuries to upper respiratory tract and lungs[Alfa Aesar MSDS] |
| Hazard Classes and Categories | Skin Corr. 1B (100%) |
| 유해 작용 | Dermatotoxin - Skin burns. |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | UN 3261 8/PG 2 |
| 관세 코드 | 29049090 |
| 위험 문구(R) | 34-36/37 |
| 위험 표시 | C |
| 안전 문구(S) | 26-27-28-36/37/39-45 |
| 포장분류 | II |
| 위험 등급 | 8Eye Dam. 1Skin Corr. 1BSTOT SE 3 |
| 위험 참고 사항 | Corrosive |
| 저장 분류 | 8A - Combustible corrosive hazardous materials |
용도
용도
2,5-Dichlorobenzenesulfonyl Chloride is used in the synthesis of sulfonamide derivatives that show antibacterial activity. It has been described as a modifier for Nylon 6.
제조 및 합성 방법
생산 방법
2,5-Dichlorobenzenesulfonyl Chloride is made by treating 1,4-dichlorobenzene with chlorosulfuric acid at 150 ℃ and stirring into ice water; yield 85%