Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-Acetamidoacrylic acid
NSC 14171 · Ac-DL-Dha-OH · 2-AcetamidoacryL · AC-DEHYDRO-ALA-OH · 2-Acetamidoacrylsure · ACETYL-DEHYDROALANINE · 2-Acetamidoacrylicaci · N-ACETYLDEHYDROALANINE
식별자 및 물리적 특성
| CAS No. | 5429-56-1 |
|---|---|
| 분자식 | C5H7NO3 |
| 평균 분자량 | 129.11 g/mol |
| 단동위원소 질량 | 129.04259308 g/mol |
| SMILES | C=C(NC(C)=O)C(=O)O |
| InChIKey | UFDFFEMHDKXMBG-UHFFFAOYSA-N |
| PubChem CID | 79482 |
| EC No. | 226-583-3 |
| DTXSID | DTXSID40202647 |
화학 및 물리적 성질
| XLogP | -0.2 |
|---|---|
| 극성 표면적 | 66.4 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 162 |
| 녹는점 | 185-186 °C (dec.) (lit.) |
| 끓는 점 | 239.15°C (rough estimate) |
| 밀도 | 1.3816 (rough estimate) |
| 굴절률 | 1.4220 (estimate) |
| 저장 조건 | Inert atmosphere,2-8°C |
| 용해도 | DMSO(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 3.53±0.11(Predicted) |
| 색상 | 미색에서 옅은 회색까지 |
| 용해도 | 거의 녹지 않음 |
| BRN | 1812032 |
| InChI | InChI=1S/C5H7NO3/c1-3(5(8)9)6-4(2)7/h1H2,2H3,(H,6,7)(H,8,9) |
| InChIKey | UFDFFEMHDKXMBG-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(NC(C)=O)=C |
| NIST | 2-Propenoic acid, 2-(acetylamino)-(5429-56-1) |
화학적 성질
white to off-white powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 45 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29241900 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36-37/39 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
2-Acetamidoacrylic acid is used as an antioxidant as well as a monomer.