Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3-Aminophthalic acid
NSC 15741 · AKOS AUF2103 · Pomalidomide M2 · 3-Aminophthalicaci · RSYY(Apremilast)-18 · o-Aminophthalic acid · 3-AMINOPHTHALIC ACID · Pomalidomide Impurity M
식별자 및 물리적 특성
| CAS No. | 5434-20-8 |
|---|---|
| 분자식 | C8H7NO4 |
| 평균 분자량 | 181.15 g/mol |
| 단동위원소 질량 | 181.0375077 g/mol |
| SMILES | Nc1cccc(C(=O)O)c1C(=O)O |
| InChIKey | WGLQHUKCXBXUDV-UHFFFAOYSA-N |
| PubChem CID | 79490 |
| ChEMBL | CHEMBL2420929 |
| EC No. | 226-595-9 |
| DTXSID | DTXSID9063879 |
화학 및 물리적 성질
| XLogP | 0.8 |
|---|---|
| 극성 표면적 | 101 |
| 수소 결합 공여자 수 | 3 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 228 |
| 녹는점 | 180-185 °C(lit.) |
| 끓는 점 | 436.4±40.0 °C(Predicted) |
| 밀도 | 1.551±0.06 g/cm3(Predicted) |
| 용해도 | 메탄올에 용해됨 |
| pKa(산도 계수) | 3.41±0.10(Predicted) |
| 물리적 상태 | 결정성 분말 |
| 색상 | 노란색 |
| 주요 응용 | 펩타이드 합성 |
| InChI | InChI=1S/C8H7NO4/c9-5-3-1-2-4(7(10)11)6(5)8(12)13/h1-3H,9H2,(H,10,11)(H,12,13) |
| InChIKey | WGLQHUKCXBXUDV-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=CC=CC(N)=C1C(O)=O |
| EPA | 3-Aminophthalic acid (5434-20-8) |
화학적 성질
Yellow crystalline powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 관세 코드 | 29224985 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-37/39 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |