Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-Methyl-3-nitrophenol
3-NITRO-O-CRESOL · 3-Nitro-o-kresol · BUTTPARK 52\11-30 · TIMTEC-BB SBB008485 · 3-Nitro-o-cresol>2-METHYL-3-NITROPHENOL · 3-NITRO-2-METHYLPHENOL · 2-Methyl-3-nitrophenyl · 3-Nitro-o-cresol (OH=1)
식별자 및 물리적 특성
| CAS No. | 5460-31-1 |
|---|---|
| 분자식 | C7H7NO3 |
| 평균 분자량 | 153.14 g/mol |
| 단동위원소 질량 | 153.04259308 g/mol |
| SMILES | Cc1c(O)cccc1[N+](=O)[O-] |
| InChIKey | GAKLFAZBKQGUBO-UHFFFAOYSA-N |
| PubChem CID | 79579 |
| EC No. | 226-739-0 |
| DTXSID | DTXSID00203034 |
화학 및 물리적 성질
| XLogP | 2.1 |
|---|---|
| 극성 표면적 | 66.1 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 154 |
| 녹는점 | 146-148 °C (lit.) |
| 끓는 점 | 147.0-152.0°C |
| 밀도 | 1.2744 (estimate) |
| 굴절률 | 1.5744 (estimate) |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 용해도 | 95% 에탄올: 용해성50mg/mL |
| pKa(산도 계수) | 9.11±0.25(Predicted) |
| 물리적 상태 | powder to crystal |
| 색상 | Light yellow to Brown to Dark green |
| BRN | 1946057 |
| InChI | InChI=1S/C7H7NO3/c1-5-6(8(10)11)3-2-4-7(5)9/h2-4,9H,1H3 |
| InChIKey | GAKLFAZBKQGUBO-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=CC([N+]([O-])=O)=C1C |
| NIST | 3-Nitro-o-cresol(5460-31-1) |
화학적 성질
Yellow to brown crystalline powder
안전 및 규제
| GHS 분류 | DangerH302 (93.8%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P262, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P316, P317, P319, P321, P330, P332+P317, P337+P317, P361+P364, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (93.8%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 2446 6.1/PG 3 |
| 관세 코드 | 29089000 |
| 위험 문구(R) | 20/21/22-36/37/38 |
| 위험 표시 | Xn,Xi |
| 안전 문구(S) | 26-36/37-36/37/39-36-24/25 |
| 포장분류 | III |
| 위험 등급 | 6.1Acute Tox. 4 DermalAcute Tox. 4 InhalationAcute Tox. 4 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| F 고인화성물질 | 10 |
| 위험 참고 사항 | Harmful |
| 저장 분류 | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
용도
용도
2-Methyl-3-nitrophenol was used as internal standard to develop a method for measurement of stable isotope ratio of methylnitrophenols in atmospheric particulate matter.