Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4'-Chloro-3'-nitroacetophenone
4-CHLORO-3-NITROACETOPHENONE · LABOTEST-BB LT00232960 · 3Nitro-4Chlorocetophenone · 4-chloro-3-niroacetophenone · 4-Chloro-3-nitriacetophenone · 4'-Chloro-3'-nitroacetophenone · 3'-NITRO-4'-CHLORO ACETOPHENONE · 1-(4-CHLORO-3-NITROPHENYL)ETHANONE
식별자 및 물리적 특성
| CAS No. | 5465-65-6 |
|---|---|
| 분자식 | C8H6ClNO3 |
| 평균 분자량 | 199.59 g/mol |
| 단동위원소 질량 | 199.00362073 g/mol |
| SMILES | CC(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChIKey | YEVPHFIFGUWSMG-UHFFFAOYSA-N |
| PubChem CID | 79596 |
| EC No. | 226-769-4 |
| DTXSID | DTXSID0022228 |
화학 및 물리적 성질
| XLogP | 2 |
|---|---|
| 극성 표면적 | 62.9 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 226 |
| 녹는점 | 99-101 °C(lit.) |
| 끓는 점 | 160°C (rough estimate) |
| 밀도 | 1.4125 (rough estimate) |
| 굴절률 | 1.6000 (estimate) |
| 저장 조건 | Store at room temperature |
| 물리적 상태 | powder to crystal |
| 색상 | White to Light yellow to Green |
| BRN | 1640627 |
| InChI | 1S/C8H6ClNO3/c1-5(11)6-2-3-7(9)8(4-6)10(12)13/h2-4H,1H3 |
| InChIKey | YEVPHFIFGUWSMG-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(Cl)c(c1)[N+]([O-])=O |
화학적 성질
light yellow powder
안전 및 규제
| GHS 분류 | WarningH315 (88%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P273, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P391, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 50 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (88%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29147000 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36-37/39 |
| 위험 참고 사항 | Irritant |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
4′-Chloro-3′-nitroacetophenone was used to prepare starting reagent for the synthesis of 6- and 7-acetyl-3-methyl-2-quinoxalinecarboxamide1,4-dioxides.
일반 설명
4′-Chloro-3′-nitroacetophenone is the intermediate formed during the synthesis of 4-chloro-3-nitrostyrene. It participates in deamination reaction of 4-chloro-5- and -3-nitro-2-aminoacetophanones.