Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-Ethylbiphenyl
4-Ethyl-1,1'-biphenyl · Nsc 60063 · 4-ETHYLBIPHENYL · p-Ethylbiphenyl · Biphenyl, 4-ethyl- · 4-Ethylbiphenyl>4-Ethylbiphenyl,99% · 1’-Biphenyl,4-ethyl-1 · 1-Ethyl-4-phenylbenzene
식별자 및 물리적 특성
| CAS No. | 5707-44-8 |
|---|---|
| 분자식 | C14H14 |
| 평균 분자량 | 182.26 g/mol |
| 단동위원소 질량 | 182.10955045 g/mol |
| SMILES | CCc1ccc(-c2ccccc2)cc1 |
| InChIKey | SRQOBNUBCLPPPH-UHFFFAOYSA-N |
| PubChem CID | 79786 |
| EC No. | 679-980-2 |
| DTXSID | DTXSID7073355 |
화학 및 물리적 성질
| XLogP | 5.1 |
|---|---|
| 극성 표면적 | 0 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 0 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 147 |
| SpringerMaterials Properties | Chemical structure |
| 녹는점 | 34-35.5°C |
| 끓는 점 | 149-149.8°C (12 mmHg) |
| 밀도 | 0.9900 (estimate) |
| 굴절률 | 1.5790 (estimate) |
| 인화점 | >110°C |
| 저장 조건 | Sealed in dry,Room Temperature |
| BRN | 1904973 |
| InChI | InChI=1S/C14H14/c1-2-12-8-10-14(11-9-12)13-6-4-3-5-7-13/h3-11H,2H2,1H3 |
| InChIKey | SRQOBNUBCLPPPH-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)=CC=C(CC)C=C1 |
| NIST | 4-Ethylbiphenyl(5707-44-8) |
| EPA | 1,1'-Biphenyl, 4-ethyl- (5707-44-8) |
안전 및 규제
| GHS 분류 | WarningH400 (100%): Very toxic to aquatic life [Warning Hazardous to the aquatic environment, acute hazard]P273, P391, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory.H302: Harmful if swallowed [Warning Acute toxicity, oral] |
|---|---|
| Hazard Classes and Categories | Aquatic Acute 1 (100%)Acute toxicity (Oral) - Category 4 |
| 운송 번호(UN) | 3077 |
| 관세 코드 | 29029090 |
| 안전 문구(S) | 24/25 |
| 포장분류 | III |
| 위험 등급 | 9 |
| 기존화학 물질 | KE-13548 |
용도
용도
Intermediates of Liquid Crystals