Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-(Methylthio)-1H-pyrimidin-4-one
2-(METHYLTHIO)PYRIMIDIN-4(3H)-ONE · 2-(Methylthio)pyriMidin-4(1H)-one · NSC 125339 · NSC 165518 · AURORA 15138 · 2-Methyl Uracil · 2-Methylthiouracil · 2-Methylthio-4-pyrim
식별자 및 물리적 특성
| CAS No. | 5751-20-2 |
|---|---|
| 분자식 | C5H6N2OS |
| 평균 분자량 | 142.18 g/mol |
| 단동위원소 질량 | 142.02008381 g/mol |
| SMILES | CSc1nccc(=O)[nH]1 |
| InChIKey | UYHSQVMHSFXUOA-UHFFFAOYSA-N |
| PubChem CID | 79823 |
| ChEBI | CHEBI:140197 |
| EC No. | 227-274-6 |
| DTXSID | DTXSID30206119 |
화학 및 물리적 성질
| XLogP | 0.5 |
|---|---|
| 극성 표면적 | 66.8 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 185 |
| SpringerMaterials Properties | Density |
| LogP(분배 계수) | 0.22 |
| 녹는점 | 200.0 to 204.0 °C |
| 밀도 | 1.35±0.1 g/cm3(Predicted) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | DMSO(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 7.80±0.40(Predicted) |
| 색상 | 흰색에서 황백색까지 |
| InChI | InChI=1S/C5H6N2OS/c1-9-5-6-3-2-4(8)7-5/h2-3H,1H3,(H,6,7,8) |
| InChIKey | UYHSQVMHSFXUOA-UHFFFAOYSA-N |
| SMILES | C1(SC)=NC=CC(=O)N1 |
| NIST | 4(1H)-Pyrimidinone, 2-(methylthio)-(5751-20-2) |
화학적 성질
White Solid
안전 및 규제
| GHS 분류 | DangerH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P354+P338, P317, P319, P321, P330, P332+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 41 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 관세 코드 | 29335990 |
| 위험 문구(R) | 22-37/38-41 |
| 안전 문구(S) | 26-39 |
용도
용도
A competitive inhibitor of Nitric Oxide Synthase (NOS).