N,N,N',N',N'',N''-Hexamethylmethanetriamine
Tris(dimethylamino)methane · Tris(N,N-dimethylamino)methane · Tris(dimethylamino)methane,85% · Tris(dimethylamino)methane 97% · Tris(dimethylamino) methane, 96%+ · Tris(diMethylaMino)Methane, 85% 5GR · N,N,N,N,N,N-HEXAMETHYLMETHANETRIAMINE · N,N',N''-Methylidynetris(dimethylamine)
식별자 및 물리적 특성
| CAS No. | 5762-56-1 |
|---|---|
| 분자식 | C7H19N3 |
| 평균 분자량 | 145.25 g/mol |
| 단동위원소 질량 | 145.15789761 g/mol |
| SMILES | CN(C)C(N(C)C)N(C)C |
| InChIKey | MUMVIYLVHVCYGI-UHFFFAOYSA-N |
| PubChem CID | 79831 |
| ChEMBL | CHEMBL3301703 |
| EC No. | 227-284-0 |
| DTXSID | DTXSID20206284 |
화학 및 물리적 성질
| XLogP | 0.6 |
|---|---|
| 극성 표면적 | 9.7 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 69.8 |
| 끓는 점 | 42-43 °C/12 mmHg (lit.) |
| 밀도 | 0.838 g/mL at 20 °C (lit.) |
| 굴절률 | n20/D 1.436(lit.) |
| 인화점 | 4 °F |
| 저장 조건 | 2-8°C |
| 물리적 상태 | 액체 |
| pKa(산도 계수) | 6.50±0.38(Predicted) |
| 색상 | 무색투명~미황색 |
| BRN | 1901162 |
| InChI | InChI=1S/C7H19N3/c1-8(2)7(9(3)4)10(5)6/h7H,1-6H3 |
| InChIKey | MUMVIYLVHVCYGI-UHFFFAOYSA-N |
| SMILES | C(N(C)C)(N(C)C)N(C)C |
화학적 성질
Clear colorless to slightly yellow liquid
안전 및 규제
| GHS 분류 | DangerH225 (100%): Highly Flammable liquid and vapor [Danger Flammable liquids]P210, P233, P240, P241, P242, P243, P260, P264, P280, P301+P330+P331, P302+P361+P354, P303+P361+P353, P304+P340, P305+P354+P338, P316, P321, P363, P370+P378, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 42 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Flam. Liq. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 2733 3/PG 2 |
| 관세 코드 | 29212900 |
| 위험 문구(R) | 11-34 |
| 위험 표시 | F,C |
| 안전 문구(S) | 16-26-36/37/39-45 |
| 포장분류 | II |
| 위험 등급 | 3.1Flam. Liq. 2Skin Corr. 1B |
| F 고인화성물질 | 3-8-10-21 |
| 위험 참고 사항 | Corrosive/Highly Flammable |
| 저장 분류 | 3 - Flammable liquids |
용도
용도
Tris(dimethylamino)methane was used:to prepare the phosphoramidite derivative of the new nucleoside analogas reagent for the introduction of the dimethylaminoethylidene group in ring-opening (RO) polymerization of lactide
일반 설명
NMR spectra and their temperature-dependence has been reported for tris(dimethylamino)methane. Tris(dimethylamino)methane reacts with crowded α-(o-nitrophenyl) ketone to yield tetrahydroquinoline derivative.