Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1-메틸산틴
1-메틸산틴 · 1-Methyl-3,7-dihydro-1H-purine-2,6-dione · METHYLXANTHINES · 1-Methyl-1H-purine-2,6(3H,7H)-dione · 1-METHYLXANTHINE · 1-methyl-xanthin · Xanthine, 1-methyl- · 1-Methyl Xanthine 1
식별자 및 물리적 특성
| CAS No. | 6136-37-4 |
|---|---|
| 분자식 | C6H6N4O2 |
| 평균 분자량 | 166.14 g/mol |
| 단동위원소 질량 | 166.04907543 g/mol |
| SMILES | Cn1c(=O)[nH]c2nc[nH]c2c1=O |
| InChIKey | MVOYJPOZRLFTCP-UHFFFAOYSA-N |
| PubChem CID | 80220 |
| ChEMBL | CHEMBL1250 |
| ChEBI | CHEBI:68444 |
| EC No. | 228-108-5 |
| DTXSID | DTXSID30210271 |
| 현지명 | 1-메틸산틴 |
화학 및 물리적 성질
| XLogP | -0.3 |
|---|---|
| 극성 표면적 | 78.1 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 242 |
| 물질 분류 | Nitrogen Compounds -> Purines |
| 의약품 | Pharmaceuticals -> Metabolite of Caffeine, Theophylline |
| LogP(분배 계수) | -0.27 |
| 용해도 | >24.9 [ug/mL] (The mean of the results at pH 7.4)수용성 염기 (약간 용해됨), DMSO (약간 용해됨) |
| Physical Description | Light yellow powder[Aldrich MSDS]Solid |
| Collision Cross Section | 124.23 Ų [M-H]- [CCS Type: DTMethod: single field calibrated with Agilent tune mix (Agilent)] |
| 녹는점 | ≥300 °C |
| 밀도 | 1.539±0.06 g/cm3(Predicted) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | pK1:7.70pK2:12.0 (25°C) |
| 색상 | 연한 노란색에서 진한 노란색까지 |
| BRN | 171507 |
| InChI | InChI=1S/C6H6N4O2/c1-10-5(11)3-4(8-2-7-3)9-6(10)12/h2H,1H3,(H,7,8)(H,9,12) |
| InChIKey | MVOYJPOZRLFTCP-UHFFFAOYSA-N |
| SMILES | N1C2=C(NC(=O)N(C)C2=O)NC=1 |
화학적 성질
Faint Yellow Solid
안전 및 규제
| GHS 분류 | WarningH302 (33.3%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 3 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 유해성 요약 | May cause irritationTargets nerves, heart, and kidney[Aldrich MSDS] See 1,7-Dimethylxanthine. See Caffeine which is 1,3,7-Trimethylxanthine. |
| Hazard Classes and Categories | Skin Irrit. 2 (66.7%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | ZD8575000 |
| 관세 코드 | 29335990 |
| 위험 문구(R) | 26/27/28 |
| 위험 표시 | T+ |
| 안전 문구(S) | 22-24/25 |
| 저장 분류 | 13 - Non Combustible Solids |
용도
용도
A metabolite of Theophylline.