Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
메틸2-메틸-3-푸로에이트
메틸2-메틸-3-푸로에이트 · Methyl 2-methylfuran-3-carboxylate · Methyl 2-methylfurane-3-carboxylate · 2-Methyl-3-furancarboxylic acid methyl ester · Compound Fr13769 · AKOS BBS-00004384 · METHYL 2-METHYL-3-FUROATE · 2-methyl-3-acidmethyl ester
식별자 및 물리적 특성
| CAS No. | 6141-58-8 |
|---|---|
| 분자식 | C7H8O3 |
| 평균 분자량 | 140.14 g/mol |
| 단동위원소 질량 | 140.04734412 g/mol |
| SMILES | COC(=O)c1ccoc1C |
| InChIKey | UVRRIABXNIGUJZ-UHFFFAOYSA-N |
| PubChem CID | 80237 |
| EC No. | 228-132-6 |
| DTXSID | DTXSID40210343 |
| 현지명 | 메틸2-메틸-3-푸로에이트 |
화학 및 물리적 성질
| XLogP | 1.2 |
|---|---|
| 극성 표면적 | 39.4 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 133 |
| 끓는 점 | 75 °C20 mm Hg(lit.) |
| 밀도 | 1.116 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.473(lit.) |
| 인화점 | 147 °F |
| 저장 조건 | 2-8°C |
| 물리적 상태 | liquid |
| BRN | 1342040 |
| InChI | InChI=1S/C7H8O3/c1-5-6(3-4-10-5)7(8)9-2/h3-4H,1-2H3 |
| InChIKey | UVRRIABXNIGUJZ-UHFFFAOYSA-N |
| SMILES | O1C=CC(C(OC)=O)=C1C |
| LogP(분배 계수) | 1.730 (est) |
화학적 성질
CLEAR YELLOW TO BROWN LIQUID
안전 및 규제
| GHS 분류 | WarningH227 (50%): Combustible liquid [Warning Flammable liquids]P210, P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P370+P378, P403, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 2 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Chemical: 3-Furancarboxylic acid, 2-methyl-, methyl ester |
| Hazard Classes and Categories | Flam. Liq. 4 (50%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29321900 |
| 안전 문구(S) | 24/25 |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
Methyl 2-methyl-3-furoate is a useful building block used in a variety of synthetic applications, such as the nickel-catalyzed amide bond formation from methyl esters, and gold-catalyzed arylation by arylsilanes.