Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3-(3-인돌릴)-2-옥소프로판산
3-(3-인돌릴)-2-옥소프로판산 · INDOLE-3-PYRUVIC ACID · Indole-3-pyruvate · ALPHA-OXO-1H-INDOLE-3-PROPANOIC ACID · indole-3-pyruvic · Indole-3-pyrubate · Indolyl-3-pyruvate · TIMTEC-BB SBB003515
식별자 및 물리적 특성
| CAS No. | 392-12-1 |
|---|---|
| 분자식 | C11H9NO3 |
| 평균 분자량 | 203.19 g/mol |
| 단동위원소 질량 | 203.05824315 g/mol |
| SMILES | O=C(O)C(=O)Cc1c[nH]c2ccccc12 |
| InChIKey | RSTKLPZEZYGQPY-UHFFFAOYSA-N |
| PubChem CID | 803 |
| ChEMBL | CHEMBL485012 |
| ChEBI | CHEBI:29750 |
| EC No. | 206-874-1 |
| DTXSID | DTXSID3042053 |
| 현지명 | 3-(3-인돌릴)-2-옥소프로판산 |
화학 및 물리적 성질
| XLogP | 1.3 |
|---|---|
| 극성 표면적 | 70.2 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 15 |
| 형식 전하 | 0 |
| 복잡도 | 277 |
| Collision Cross Section | 141.6 Ų [M-H]- [CCS Type: DTBuffer gas: N2Ionization: ESI-Dataset: TOXCASTSource Identifier: DTXSID3042053]138.82 Ų [M-H]- [CCS Type: DTMethod: single field calibrated with Agilent tune mix (Agilent)]137.6 Ų [M-H]- [CCS Type: DTMethod: single field calibrated with ESI Low Concentration Tuning Mix (Agilent)]137.8 Ų [M-H]- |
| 녹는점 | 215 °C (dec.)(lit.) |
| 끓는 점 | 341.49°C (rough estimate) |
| 밀도 | 1.2621 (rough estimate) |
| 굴절률 | 1.4950 (estimate) |
| 저장 조건 | -20°C |
| 용해도 | DMSO(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 2.61±0.54(Predicted) |
| 색상 | 연노랑 |
| BRN | 172966 |
| InChI | 1S/C11H9NO3/c13-10(11(14)15)5-7-6-12-9-4-2-1-3-8(7)9/h1-4,6,12H,5H2,(H,14,15) |
| InChIKey | RSTKLPZEZYGQPY-UHFFFAOYSA-N |
| SMILES | OC(=O)C(=O)Cc1c[nH]c2ccccc12 |
| NIST | Indole-3-pyruvic acid(392-12-1) |
| EPA | Indole-3-pyruvic acid (392-12-1) |
화학적 성질
light beige to light brown powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | NM1880000 |
| 관세 코드 | 2933998090 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36-24/25 |
| F 고인화성물질 | 8-10-23 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Indole-3-pyruvic acid can be used:As a precursor for the synthesis of chromopyrrolic acid by a heme-containing enzyme.As a reactant in the Biginelli-like scaffold syntheses.