Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Propyltriphenylphosphonium bromide
NSC 50539 · triphenyl(prop · Triphenylpropylphosp · Phosphonium,triphenylpropyl- · PropyltriphenylphosphoniuM bro · PROPYLTRIPHENYLPHOSPHONIUM BROMIDE · Propyltriphenylphosphonium bromlde · triphenyl(propyl)phosphanium bromide
식별자 및 물리적 특성
| CAS No. | 1703757-22-5 |
|---|---|
| 분자식 | C21H22BrP |
| 평균 분자량 | 385.3 g/mol |
| 단동위원소 질량 | 384.06424943 g/mol |
| SMILES | CCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
| InChIKey | XMQSELBBYSAURN-UHFFFAOYSA-M |
| PubChem CID | 80374 |
| ChEMBL | CHEMBL3334701 |
| EC No. | 228-330-2 |
| DTXSID | DTXSID80977847 |
화학 및 물리적 성질
| 극성 표면적 | 0 |
|---|---|
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 5 |
| 무거운 원자 수 | 23 |
| 형식 전하 | 0 |
| 복잡도 | 260 |
| 녹는점 | 236-238 °C |
| 저장 조건 | Keep in dark place,Inert atmosphere,Room temperature |
| 용해도 | DMSO(약간 용해됨, 가열), 메탄올(약간 용해됨) |
| 물리적 상태 | 고체 |
| 색상 | 흰색에서 황백색까지 |
| 용해도 | 녹는 |
| BRN | 3599726 |
| 안정성 | 흡습성 |
| InChI | InChI=1S/C21H22P.BrH/c1-2-18-22(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-17H,2,18H2,1H31H/q+1/p-1 |
| InChIKey | XMQSELBBYSAURN-UHFFFAOYSA-M |
| SMILES | [P+](CCC)(C1C=CC=CC=1)(C1C=CC=CC=1)C1=CC=CC=C1.[Br-] |
화학적 성질
White crystalline powder
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 2% (1 of 50) of reports.WarningH302 (86%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 50 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Status: Active Update: 12-12-2019 https://echa.europa.eu/registration-dossier/-/registered-dossier/30276 |
| Hazard Classes and Categories | Acute Tox. 4 (86%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29319090 |
| 위험 문구(R) | 36/37/38-21/22 |
| 위험 표시 | Xn |
| 안전 문구(S) | 36/37-36/37/39-26 |
| F 고인화성물질 | 3-8 |
| 위험 등급 | Acute Tox. 4 Oral |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
n-Propyltriphenylphosphonium Bromide, is an analogue of phosphonium, acting as reversible inhibitors of cholinesterases of different animals. It has also been shown to be part of Phosphonium salts, having antiviral activity against influenza virus A.