Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-클로로-알파,알파-디메틸페닐아세트산
4-클로로-알파,알파-디메틸페닐아세트산 · 2-(4-Chlorophenyl)-2-methylpropanoic acid · 2-(4-CHLOROPHENYL)-2-METHYLPROPIONIC ACID · TIMTEC-BB SBB003559 · 2-(4-chlorophenyl)-2-methylpropanoate · 4-Chloro-α,α-dimethylphenylaceticacid · 4-chloro-à,à-dimethylphenylacetic acid · 4-Chloro-α,α-dimethylphenylacetic acid
식별자 및 물리적 특성
| CAS No. | 6258-30-6 |
|---|---|
| 분자식 | C10H11ClO2 |
| 평균 분자량 | 198.64 g/mol |
| 단동위원소 질량 | 198.04475727 g/mol |
| SMILES | CC(C)(C(=O)O)c1ccc(Cl)cc1 |
| InChIKey | SSFDAZXGUKDEAH-UHFFFAOYSA-N |
| PubChem CID | 80406 |
| EC No. | 228-392-0 |
| DTXSID | DTXSID60978155 |
| 현지명 | 4-클로로-알파,알파-디메틸페닐아세트산 |
화학 및 물리적 성질
| XLogP | 2.9 |
|---|---|
| 극성 표면적 | 37.3 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 193 |
| 녹는점 | 122-127 °C |
| 끓는 점 | 285.11°C (rough estimate) |
| 밀도 | 1.1698 (rough estimate) |
| 굴절률 | 1.5500 (estimate) |
| 저장 조건 | Store at room temperature |
| pKa(산도 계수) | 4.26±0.10(Predicted) |
| BRN | 2094056 |
화학적 성질
white fine powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 5 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29163900 |
| 위험 문구(R) | 36/37/38-41-37/38-22 |
| 위험 표시 | Xi,Xn |
| 안전 문구(S) | 37/39-26-39 |