Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-Chloro-2-nitrobenzoic acid
4,2-CNBA · 4-Chloro-2-Nitrobenzoic · 4-chloro-2-nitrobenzoate · 4-Chloro-2-nitrobenzoicaci · 2-Nitro-4-chlorobenzoic acid · 4-CHLORO-2-NITROBENZOIC ACID · 2-Carboxy-5-chloronitrobenzene · Benzoic acid, 4-chloro-2-nitro-
식별자 및 물리적 특성
| CAS No. | 6280-88-2 |
|---|---|
| 분자식 | C7H4ClNO4 |
| 평균 분자량 | 201.56 g/mol |
| 단동위원소 질량 | 200.98288529 g/mol |
| SMILES | O=C(O)c1ccc(Cl)cc1[N+](=O)[O-] |
| InChIKey | JAHIPDTWWVYVRV-UHFFFAOYSA-N |
| PubChem CID | 80475 |
| EC No. | 228-483-5 |
| DTXSID | DTXSID80211899 |
화학 및 물리적 성질
| XLogP | 2.1 |
|---|---|
| 극성 표면적 | 83.1 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 227 |
| SpringerMaterials Properties | Nuclear quadrupole resonance spectroscopy |
| 녹는점 | 141-143 °C (lit.) |
| 끓는 점 | 160.5°C (rough estimate) |
| 밀도 | 1.5 |
| 굴절률 | 1.6000 (estimate) |
| 인화점 | >100°C |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | 5.3g/L |
| pKa(산도 계수) | 1.97±0.25(Predicted) |
| 물리적 상태 | powder to crystal |
| 색상 | 흰색에서 밝은 노란색 |
| 용해도 | 0.53g/100mL(15℃) |
| BRN | 2051370 |
| InChI | 1S/C7H4ClNO4/c8-4-1-2-5(7(10)11)6(3-4)9(12)13/h1-3H,(H,10,11) |
| InChIKey | JAHIPDTWWVYVRV-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccc(Cl)cc1[N+]([O-])=O |
| NIST | 4-Chloro-2-nitrobenzoic acid(6280-88-2) |
화학적 성질
light yellow to light yellow-green crystalline
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 46 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Status: Cease Manufacture Update: 04-08-2017 https://echa.europa.eu/registration-dossier/-/registered-dossier/202404-Chloro-2-nitrobenzoic acid: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 2811 6.1/PG 3 |
| 관세 코드 | 29163900 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36-24/25 |
| 위험 참고 사항 | Irritant |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |