Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1-Cyclopentylpiperazine
BUTTPARK 82\06-05 · TIMTEC-BB SBB004031 · RARECHEM AH CK 0078 · cyclopentylpiperazine · Piperazine Impurity 6 · 1-CYCLOPENTYLPIPERAZINE · N-CYCLOPENTYLPIPERAZINE · 1-Cyanopentylpiperazine
식별자 및 물리적 특성
| CAS No. | 21043-40-3 |
|---|---|
| 분자식 | C9H18N2 |
| 평균 분자량 | 154.25 g/mol |
| 단동위원소 질량 | 154.14699858 g/mol |
| SMILES | C1CCC(N2CCNCC2)C1 |
| InChIKey | PVMCQBPJKPMOKM-UHFFFAOYSA-N |
| PubChem CID | 806421 |
| EC No. | 671-072-4 |
| DTXSID | DTXSID80355565 |
화학 및 물리적 성질
| XLogP | 0.9 |
|---|---|
| 극성 표면적 | 15.3 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 113 |
| 끓는 점 | 48 °C |
| 밀도 | 0.989±0.06 g/cm3(Predicted) |
| 굴절률 | 1.5000 to 1.5040 |
| 저장 조건 | 2-8°C |
| 용해도 | DMSO(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 오일-젤 |
| pKa(산도 계수) | 9.28±0.10(Predicted) |
| 색상 | 무색~담황색 |
| InChI | InChI=1S/C9H18N2/c1-2-4-9(3-1)11-7-5-10-6-8-11/h9-10H,1-8H2 |
| InChIKey | PVMCQBPJKPMOKM-UHFFFAOYSA-N |
| SMILES | N1(C2CCCC2)CCNCC1 |
안전 및 규제
| GHS 분류 | DangerH302 (33.3%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P305+P354+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 3 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (33.3%) |
| 관세 코드 | 2933599590 |
| 위험 문구(R) | 36/37/38-22 |
| 위험 표시 | Xi,Xn |
| 안전 문구(S) | 26-36/37/39 |
| 위험 등급 | IRRITANT |
용도
용도
1-Cyclopentylpiperazine is used in the synthesis of quinolines as a new class of imidazole-free H3 receptor antagonists. Also used to prepare a series of estrogen receptor modulators.