Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
디메틸에틸렌디아민
디메틸에틸렌디아민 · N,N＼'-다이메틸에틸렌다이아민 · DMEDA · N,N'-Dimethylethylenediamine · SYM-DIMETHYLETHYLENEDIAMINE · DIMETHYLETHYLENEDIAMINE · DMEN · N,N'-dimethylethane-1,2-diamine
식별자 및 물리적 특성
| CAS No. | 110-70-3 |
|---|---|
| 분자식 | C4H12N2 |
| 평균 분자량 | 88.15 g/mol |
| 단동위원소 질량 | 88.10004838 g/mol |
| SMILES | CNCCNC |
| InChIKey | KVKFRMCSXWQSNT-UHFFFAOYSA-N |
| PubChem CID | 8070 |
| EC No. | 203-793-3 |
| DTXSID | DTXSID4058730 |
| 현지명 | 디메틸에틸렌디아민 |
화학 및 물리적 성질
| XLogP | -0.6 |
|---|---|
| 극성 표면적 | 24.1 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 6 |
| 형식 전하 | 0 |
| 복잡도 | 17.5 |
| 물질 분류 | Nitrogen Compounds -> Amines, Aliphatic |
| SpringerMaterials Properties | Optical coefficient |
| 증기압 | 20.6 [mmHg] |
| Physical Description | Clear light yellow liquid[Sigma-Aldrich MSDS] |
| 녹는점 | 1.63°C (estimate) |
| 끓는 점 | 119 °C(lit.) |
| 밀도 | 0.819 g/mL at 20 °C(lit.) |
| 굴절률 | n20/D 1.431(lit.) |
| 인화점 | 83 °F |
| 저장 조건 | Keep in dark place,Inert atmosphere,2-8°C |
| 용해도 | 클로로포름 및 디클로로메탄과 혼합 가능. |
| 물리적 상태 | 액체 |
| pKa(산도 계수) | 10.54±0.10(Predicted) |
| 비중 | 0.828 |
| 색상 | 무색투명~미황색 |
| BRN | 878142 |
| InChI | 1S/C4H12N2/c1-5-3-4-6-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | KVKFRMCSXWQSNT-UHFFFAOYSA-N |
| SMILES | CNCCNC |
| LogP(분배 계수) | -0.620 |
| NIST | CH3NHCH2CH2NHCH3(110-70-3) |
| EPA | 1,2-Ethanediamine, N,N'-dimethyl- (110-70-3) |
화학적 성질
Clear Colourless Oil
안전 및 규제
| GHS 분류 | DangerH226 (98.9%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P260, P261, P264, P264+P265, P271, P280, P301+P330+P331, P302+P352, P302+P361+P354, P303+P361+P353, P304+P340, P305+P351+P338, P305+P354+P338, P316, P317, P319, P321, P332+P317, P337+P317, P362+P364, P363, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 89 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 유해성 요약 | Intraperitoneal LD50 (mouse) = 200 mg/kg[RTECS] Causes burnsInhalation may cause corrosive injuries to upper respiratory tract and lungs[Sigma-Aldrich MSDS] |
| Hazard Classes and Categories | Flam. Liq. 3 (98.9%) |
| 유해 작용 | Dermatotoxin - Skin burns. |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | KV4250000 |
| 운송 번호(UN) | UN 2734 8/PG 2 |
| 독성 | mouse,LD50,intraperitoneal,200mg/kg (200mg/kg),European Journal of Medicinal Chemistry--Chimie Therapeutique. Vol. 17, Pg. 235, 1982. |
| 관세 코드 | 29212900 |
| 위험 문구(R) | 10-34-20/21/22 |
| 위험 표시 | C |
| 안전 문구(S) | 26-36/37/39-45-16 |
| 포장분류 | III |
| 위험 등급 | 3Eye Dam. 1Flam. Liq. 3Skin Corr. 1B |
| 저장 분류 | 3 - Flammable liquids |
용도
용도
N,N'-Dimethylethylenediamine is used in DNA binding effect. It is used to enhance the adsorption of carbon dioxide. It acts as a ligand and form coordination complex such as dinitrato(N,N'-dimethyl-1,2-ethanediamine)copper(II) and dichloro(1,4-bis-(diphenyl phosphino)butane)-(1,2-ethylenediamine)ruthenium(II).