사이클로 헥 실디 페닐 포스 핀
사이클로헥실디페닐포스핀 · DIPHENYLCYCLOHEXYLPHOSPHINE · CYCLOHEXYLDI · Cyclohexyldiphenylphospine · whitextl · Phosphine, cycL · Cyclohexyldihenylphosphine · CYCLOHEXYLDIPHENYLPHOSPHINE
식별자 및 물리적 특성
| CAS No. | 6372-42-5 |
|---|---|
| 분자식 | C18H21P |
| 평균 분자량 | 268.3 g/mol |
| 단동위원소 질량 | 268.1380873 g/mol |
| SMILES | c1ccc(P(c2ccccc2)C2CCCCC2)cc1 |
| InChIKey | ZXKWUYWWVSKKQZ-UHFFFAOYSA-N |
| PubChem CID | 80756 |
| EC No. | 228-904-2 |
| DTXSID | DTXSID6074671 |
| 현지명 | 사이클로 헥 실디 페닐 포스 핀 |
화학 및 물리적 성질
| XLogP | 4.9 |
|---|---|
| 극성 표면적 | 0 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 0 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 19 |
| 형식 전하 | 0 |
| 복잡도 | 226 |
| 녹는점 | 58-62 °C(lit.) |
| 끓는 점 | 374.0±11.0 °C(Predicted) |
| 인화점 | >230 °F |
| 저장 조건 | Keep in dark place,Inert atmosphere,Room temperature |
| 물리적 상태 | 가루 |
| 색상 | 하얀색 |
| 용해도 | 불용성 |
| InChI | InChI=1S/C18H21P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-2,4-7,10-13,18H,3,8-9,14-15H2 |
| InChIKey | ZXKWUYWWVSKKQZ-UHFFFAOYSA-N |
| SMILES | P(C1CCCCC1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| EPA | Phosphine, cyclohexyldiphenyl- (6372-42-5) |
화학적 성질
white to light yellow crystal powde
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 20% (1 of 5) of reports.WarningH302 (40%): Harmful if swallowed [Warning Acute toxicity, oral]P260, P261, P264, P264+P265, P270, P271, P272, P273, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P333+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 5 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (40%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | No |
| RTECS 번호 | SY8387500 |
| 관세 코드 | 29319090 |
| 위험 문구(R) | 36/37/38 |
| 안전 문구(S) | 24/25 |
| 기존화학 물질 | 2015-3-6439 |
| 저장 분류 | 11 - Combustible Solids |
용도
개요
Cyclohexyldiphenylphosphine is a chemical compound commonly used as a ligand in coordination chemistry and organometallic synthesis. It acts as a stabilizing agent and facilitates various catalytic reactions. This compound finds applications in pharmaceuticals, fine chemicals, and materials science industries. Cyclohexyldiphenylphosphine should be handled with caution as it may cause skin and eye irritation. It should be stored in a cool, well-ventilated area away from heat sources or open flames. Proper personal protective equipment (PPE) should be worn when handling this compound. Not for human consumption. Such as Silver(I) phosphine complexes were synthesized by a reaction of AgNO3, AgCl, and AgBr with cyclohexyl diphenylphosphine to produce 1:1, 1:2, or 1:3 molar ratios of new silver complexes[1].
용도
Cyclohexyldiphenylphosphine is used as ligand in coupling reaction. It is also used as a medical intermediate.