Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2,3-Difluorophenol
Difluorophenol · 3-Difluorophenol · 2,3-DIFLUOROPHENOL · 2,3-Difluorophenole · PHENOL, 2,3-DIFLUORO- · 2,3-Difluorophenol>2,3-Difluorophenol 98% · 2,3-Difluorophenol,98+% · 2,3-Difluorophenol ,99%
식별자 및 물리적 특성
| CAS No. | 6418-38-8 |
|---|---|
| 분자식 | C6H4F2O |
| 평균 분자량 | 130.09 g/mol |
| 단동위원소 질량 | 130.02302119 g/mol |
| SMILES | Oc1cccc(F)c1F |
| InChIKey | RPEPGIOVXBBUMJ-UHFFFAOYSA-N |
| PubChem CID | 80879 |
| EC No. | 628-249-6 |
| DTXSID | DTXSID40214381 |
화학 및 물리적 성질
| XLogP | 1.8 |
|---|---|
| 극성 표면적 | 20.2 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 97.1 |
| 녹는점 | 39-42 °C (lit.) |
| 끓는 점 | 54 °C/25 mmHg (lit.) |
| 밀도 | 1.2483 (estimate) |
| 인화점 | 134 °F |
| 저장 조건 | Inert atmosphere,2-8°C |
| pKa(산도 계수) | 7.71±0.10(Predicted) |
| 물리적 상태 | powder to lump to clear liquid |
| 색상 | White or Colorless to Almost white or Almost colorless |
| BRN | 2082265 |
| InChI | InChI=1S/C6H4F2O/c7-4-2-1-3-5(9)6(4)8/h1-3,9H |
| InChIKey | RPEPGIOVXBBUMJ-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=CC(F)=C1F |
화학적 성질
white crystalline low melting mass
안전 및 규제
| GHS 분류 | DangerH226 (83.3%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P260, P261, P264, P264+P265, P270, P271, P280, P301+P317, P301+P330+P331, P302+P352, P302+P361+P354, P303+P361+P353, P304+P340, P305+P351+P338, P305+P354+P338, P316, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P363, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Flam. Liq. 3 (83.3%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 1325 4.1/PG 2 |
| 관세 코드 | 29081000 |
| 위험 문구(R) | 11-22-36/37/38-34-20/21/22 |
| 위험 표시 | F,Xn,Xi,C |
| 안전 문구(S) | 26-45-36/37/39-16 |
| 포장분류 | III |
| 위험 등급 | 4.1Acute Tox. 4 OralEye Irrit. 2Flam. Liq. 3Skin Irrit. 2STOT SE 3 |
| 위험 참고 사항 | Irritant |
| 저장 분류 | 3 - Flammable liquids |
용도
용도
Intermediates of Liquid Crystals