Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
N-Benzylglycine ethyl ester
ethyl benzylglycinate · ETHYL 2-(BENZYLAMINO)ACETATE · Ethyl N-benzylglycinate · AKOS 229 · C11H15NO2 · BZL-GLY-OET · N-BZL-GLY-OET · N-Bzl-Gly-Oet-OH
식별자 및 물리적 특성
| CAS No. | 6436-90-4 |
|---|---|
| 분자식 | C11H15NO2 |
| 평균 분자량 | 193.24 g/mol |
| 단동위원소 질량 | 193.11027872 g/mol |
| SMILES | CCOC(=O)CNCc1ccccc1 |
| InChIKey | ULOLIZHBYWAICY-UHFFFAOYSA-N |
| PubChem CID | 80908 |
| EC No. | 229-218-6 |
| DTXSID | DTXSID90214578 |
화학 및 물리적 성질
| XLogP | 1.6 |
|---|---|
| 극성 표면적 | 38.3 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 6 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 165 |
| 물질 분류 | Nitrogen Compounds -> Other Aromatics (Nitrogen) |
| SpringerMaterials Properties | Optical coefficient |
| Physical Description | Colorless or yellow liquid[Alfa Aesar MSDS] |
| 끓는 점 | 140-142 °C/10 mmHg (lit.) |
| 밀도 | 1.031 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.506(lit.) |
| 인화점 | >230 °F |
| 저장 조건 | 2-8°C |
| 물리적 상태 | 액체 |
| pKa(산도 계수) | 6.84±0.20(Predicted) |
| 색상 | 무색투명~연황색 |
| 용해도 | 물에 섞이거나 혼합하기 어렵지 않습니다. |
| BRN | 2104816 |
| InChI | InChI=1S/C11H15NO2/c1-2-14-11(13)9-12-8-10-6-4-3-5-7-10/h3-7,12H,2,8-9H2,1H3 |
| InChIKey | ULOLIZHBYWAICY-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)CNCC1=CC=CC=C1 |
| NIST | N-Benzylglycine ethyl ester(6436-90-4) |
화학적 성질
clear colourless to light yellow liquid
안전 및 규제
| GHS 분류 | DangerH314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P264, P264+P265, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P317, P321, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 4 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 유해성 요약 | May cause irritation[Alfa Aesar MSDS] |
| Hazard Classes and Categories | Skin Corr. 1B (100%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN2735 |
| 관세 코드 | 29224999 |
| 위험 문구(R) | 34-36/37/38-20/21/22 |
| 위험 표시 | C,Xi,Xn |
| 안전 문구(S) | 23-24/25-45-36/37/39-26-36 |
용도
용도
N-Benzylglycine ethyl ester is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff field.