Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Methylcarbamoyl chloride
Methylcarbamic chloride · n-methylaminoformyl chloride · N-Methylchloroformamide · METHYLCARBAMOYLCHLORIDE · methylamineylformylchloro · METHYLAMINOFORMYL CHLORIDE · Carbamic chloride, methyl- · N-Methylcarbamoyl chloride
식별자 및 물리적 특성
| CAS No. | 6452-47-7 |
|---|---|
| 분자식 | C2H4ClNO |
| 평균 분자량 | 93.51 g/mol |
| 단동위원소 질량 | 92.99814143 g/mol |
| SMILES | CNC(=O)Cl |
| InChIKey | GRRYSIXDUIAUGY-UHFFFAOYSA-N |
| PubChem CID | 80931 |
| EC No. | 229-253-7 |
| DTXSID | DTXSID60214787 |
화학 및 물리적 성질
| XLogP | 0.6 |
|---|---|
| 극성 표면적 | 29.1 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 5 |
| 형식 전하 | 0 |
| 복잡도 | 44.9 |
| 녹는점 | 45°C |
| 끓는 점 | 93°C (dec.) |
| 밀도 | 1.185±0.06 g/cm3(Predicted) |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2-8°C |
| 용해도 | 아세토니트릴, 클로로포름(약간 용해됨), DMSO에 용해됨 |
| pKa(산도 계수) | 10.67±0.46(Predicted) |
| 물리적 상태 | 고체 |
| 색상 | 흰색에서 황백색까지 |
| 안정성 | 공기 민감성, 흡습성, 수분 민감성, 휘발성 |
| InChI | InChI=1S/C2H4ClNO/c1-4-2(3)5/h1H3,(H,4,5) |
| InChIKey | GRRYSIXDUIAUGY-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)NC |
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P301+P317, P330, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 2 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 수질 위해 등급(WGK) | WGK 3 |
| 위험 문구(R) | 22 |
| 위험 표시 | Xn |
| 위험 등급 | Acute Tox. 4 Oral |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Methylcarbamoyl Chloride is used as a reagent in the synthesis of acylprolinamides as a new class of peptide deformylase inhibitors with in vivo antibacterial activity. Methylcarbamoyl Chloride is also used as a reagent in the synthesis of carbamate derivatives as potential dual-binding site acetylcholinesterase inhibitors.