Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
HCID 809338생성일: 2026년 11월 3일
N-벤질-4-tert-부틸벤즈아미드
N-벤질-4-tert-부틸벤즈아미드 · N-benzyl-4-tert-butylbenzamide · 4-(1,1-Dimethylethyl)-N-(phenylmethyl)benzamide · Benzamide, 4-(1,1-dimethylethyl)-N-(phenylmethyl)-
https://huagongshe.com/ko/chemical/809338
식별자 및 물리적 특성
| CAS No. | 101927-55-3 |
|---|
| 분자식 | C18H21NO |
|---|
| 평균 분자량 | 267.4 g/mol |
|---|
| 단동위원소 질량 | 267.16231429 g/mol |
|---|
| SMILES | CC(C)(C)c1ccc(C(=O)NCc2ccccc2)cc1 |
|---|
| InChIKey | YDWFQKUSPZKUPI-UHFFFAOYSA-N |
|---|
| PubChem CID | 809338 |
|---|
| ChEMBL | CHEMBL1517587 |
|---|
| EC No. | 651-538-3 |
|---|
| DTXSID | DTXSID601245126 |
|---|
| 현지명 | N-벤질-4-tert-부틸벤즈아미드 |
|---|
화학 및 물리적 성질
| XLogP | 3.9 |
|---|
| 극성 표면적 | 29.1 |
|---|
| 수소 결합 공여자 수 | 1 |
|---|
| 수소 결합 수용자 수 | 1 |
|---|
| 회전 가능 결합 수 | 4 |
|---|
| 무거운 원자 수 | 20 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 304 |
|---|
| 용해도 | <0.6 [ug/mL] (The mean of the results at pH 7.4) |
|---|
| 녹는점 | 143-144 °C(Solv: dichloromethane (75-09-2)hexane (110-54-3)) |
|---|
| 끓는 점 | 433.2±34.0 °C(Predicted) |
|---|
| 밀도 | 1.039±0.06 g/cm3(Predicted) |
|---|
| pKa(산도 계수) | 15.14±0.46(Predicted) |
|---|
안전 및 규제
| GHS 분류 | WarningH319 (100%): Causes serious eye irritation [Warning Serious eye damage/eye irritation]P264+P265, P273, P280, P305+P351+P338, P337+P317, P391, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Eye Irrit. 2 (100%) |
|---|
| 신호 어 | Warning |
|---|
| 유해·위험 문구 | 암호 유해·위험 문구 위험 등급 범주 신호 어 그림 문자 P- 코드 H319 |
|---|
