Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
디시클로헥실페닐포스핀
디시클로헥실페닐포스핀 · Dicyclohexyphenylphosphine · PHENYLPHOSPHINODICYCLOHEXANE · Dicyclohexyphenylphosphin · Dicyclohexylphenylphosphane · phenyldicyclohexylphosphine · dicyclohexylphenyl-phosphin · DICYCLOHEXYLPHENYLPHOSPHINE
식별자 및 물리적 특성
| CAS No. | 6476-37-5 |
|---|---|
| 분자식 | C18H27P |
| 평균 분자량 | 274.4 g/mol |
| 단동위원소 질량 | 274.18503786 g/mol |
| SMILES | c1ccc(P(C2CCCCC2)C2CCCCC2)cc1 |
| InChIKey | VPLLTGLLUHLIHA-UHFFFAOYSA-N |
| PubChem CID | 80970 |
| EC No. | 229-334-7 |
| DTXSID | DTXSID0073372 |
| 현지명 | 디시클로헥실페닐포스핀 |
화학 및 물리적 성질
| XLogP | 5.1 |
|---|---|
| 극성 표면적 | 0 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 0 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 19 |
| 형식 전하 | 0 |
| 복잡도 | 226 |
| 녹는점 | 60-61 °C (lit.) |
| 끓는 점 | 391.8±11.0 °C(Predicted) |
| 저장 조건 | 2-8°C, protect from light, stored under nitrogen |
| 물리적 상태 | 결정성 분말 |
| 색상 | 흰색에서 황백색까지 |
| 용해도 | 물에 불용성. |
| InChI | InChI=1S/C18H27P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1,4-5,10-11,17-18H,2-3,6-9,12-15H2 |
| InChIKey | VPLLTGLLUHLIHA-UHFFFAOYSA-N |
| SMILES | P(C1CCCCC1)(C1CCCCC1)C1=CC=CC=C1 |
| NIST | Dicyclohexylphenylphosphine(6476-37-5) |
| EPA | Phosphine, dicyclohexylphenyl- (6476-37-5) |
화학적 성질
White to off-white crystalline powder
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P301+P317, P330, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 45 reports by companies from 3 notifications to the ECHA C&L Inventory. |
|---|---|
| 규제 정보 | PMN - indicates a commenced PMN (Pre-Manufacture Notices) substance. |
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | SY9125000 |
| 관세 코드 | 29310099 |
| 위험 문구(R) | 22 |
| 위험 표시 | Xn |
| 안전 문구(S) | 36 |
| 기존화학 물질 | KE-10273 |
| 위험 등급 | Acute Tox. 4 Oral |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Dicyclohexylphenylphosphine is an organic phosphine compound, which can be used as a raw material for organic synthesis.