Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1,4-Diethylpiperazine
DEPP · TIMTEC-BB SBB008748 · 1,4-Diethylpiperazine · N,N'-DIETHYLPIPERAZINE · N,N’-Diethyl piperizine · Abemaciclib Impurity 92 · Piperazine, 1,4-diethyl- · 1,4-Diethylpiperazine,98%
식별자 및 물리적 특성
| CAS No. | 6483-50-7 |
|---|---|
| 분자식 | C8H18N2 |
| 평균 분자량 | 142.24 g/mol |
| 단동위원소 질량 | 142.14699858 g/mol |
| SMILES | CCN1CCN(CC)CC1 |
| InChIKey | DDPRYTUJYNYJKV-UHFFFAOYSA-N |
| PubChem CID | 80973 |
| EC No. | 229-341-5 |
| DTXSID | DTXSID5073373 |
화학 및 물리적 성질
| XLogP | 0.8 |
|---|---|
| 극성 표면적 | 6.5 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 73.3 |
| 끓는 점 | 156-158 °C |
| 밀도 | 0.9 |
| 굴절률 | 1.453-1.455 |
| 저장 조건 | 2-8°C |
| 용해도 | 메탄올, 톨루엔에 용해됩니다. |
| pKa(산도 계수) | 8.20±0.10(Predicted) |
| InChI | InChI=1S/C16H21NO3.ClH/c1-17-12-7-8-13(17)10-14(9-12)20-16(19)15(18)11-5-3-2-4-6-11/h2-6,12-15,18H,7-10H2,1H31H/t12-,13+,14+,15 |
| InChIKey | DDPRYTUJYNYJKV-UHFFFAOYSA-N |
| SMILES | N1(CCN(CC1)CC)CC |
| EPA | Piperazine, 1,4-diethyl- (6483-50-7) |
화학적 성질
clear colorless to yellow liquid
안전 및 규제
| GHS 분류 | DangerH226 (20%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P260, P261, P264, P264+P265, P271, P280, P301+P330+P331, P302+P352, P302+P361+P354, P303+P361+P353, P304+P340, P305+P351+P338, P305+P354+P338, P316, P317, P319, P321, P332+P317, P337+P317, P362+P364, P363, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 5 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Flam. Liq. 3 (20%) |
| 수질 위해 등급(WGK) | WGK 3 |
| 관세 코드 | 29335995 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 37/39-26 |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
1,4-Diethylpiperazine is used as pharmaceutical intermediate.