Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-Benzyloxyphenylacetic acid
2-(4-(benzyloxy)phenyl)acetic acid · NISTC6547531 · BUTTPARK 146\04-05 · RARECHEM AL BO 1522 · Atenolol Impurity 14 · tert-Amyl Alcohol LR · Benzyloxyphenylaceticacid · 4-Benzyloxyphenylessigsure
식별자 및 물리적 특성
| CAS No. | 6547-53-1 |
|---|---|
| 분자식 | C15H14O3 |
| 평균 분자량 | 242.27 g/mol |
| 단동위원소 질량 | 242.09429431 g/mol |
| SMILES | O=C(O)Cc1ccc(OCc2ccccc2)cc1 |
| InChIKey | XJHGAJLIKDAOPE-UHFFFAOYSA-N |
| PubChem CID | 81033 |
| EC No. | 229-463-9 |
| DTXSID | DTXSID80215791 |
화학 및 물리적 성질
| XLogP | 2.7 |
|---|---|
| 극성 표면적 | 46.5 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 5 |
| 무거운 원자 수 | 18 |
| 형식 전하 | 0 |
| 복잡도 | 250 |
| LogP(분배 계수) | 2.85 |
| 녹는점 | 119-123 °C (lit.) |
| 끓는 점 | 418.8±25.0 °C(Predicted) |
| 밀도 | 1.201±0.06 g/cm3(Predicted) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 물리적 상태 | 결정성 분말 |
| pKa(산도 계수) | 4.44±0.10(Predicted) |
| 색상 | 하얀색 |
| 용해도 | 89.9mg/L(25℃) |
| InChI | InChI=1S/C15H14O3/c16-15(17)10-12-6-8-14(9-7-12)18-11-13-4-2-1-3-5-13/h1-9H,10-11H2,(H,16,17) |
| InChIKey | XJHGAJLIKDAOPE-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=C(OCC2=CC=CC=C2)C=C1 |
| NIST | 4-Benzyloxyphenyl acetic acid(6547-53-1) |
화학적 성질
White crystalline powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 5 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29189900 |
| 위험 문구(R) | 20/21/22-36/37/38 |
| 위험 표시 | Xi,Xn |
| 안전 문구(S) | 26-36-24/25 |
| 위험 참고 사항 | Irritant |
| 저장 분류 | 13 - Non Combustible Solids |
용도
일반 설명
(4-Benzyloxy)phenylacetic acid is a para-substituted phenyl-acetic acid derivative. Its crystals belong to the triclinic crystal system. Molecules of (4-benzyloxy)phenylacetic acid exists in centrosymmetric dimeric forms linked by double hydrogen bonds between carboxyl groups.