Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2,4-Dichlorobenzonitrile
AKOS B004070 · 2,4-Dichlorobenzonit · 4-Dichlorobenzonitrile · Furosemide Impurity 58 · 2,4-Dichlor-Benzonitril · 2,4-DICHLOROBENZONITRILE · 2,4-Dichlorobenzonitrile>Benzonitrile, 2,4-dichloro- · 2,4-Dichlorobenzonitrile,98%
식별자 및 물리적 특성
| CAS No. | 6574-98-7 |
|---|---|
| 분자식 | C7H3Cl2N |
| 평균 분자량 | 172.01 g/mol |
| 단동위원소 질량 | 170.96425446 g/mol |
| SMILES | N#Cc1ccc(Cl)cc1Cl |
| InChIKey | GRUHREVRSOOQJG-UHFFFAOYSA-N |
| PubChem CID | 81050 |
| EC No. | 229-493-2 |
| DTXSID | DTXSID30215943 |
화학 및 물리적 성질
| XLogP | 2.6 |
|---|---|
| 극성 표면적 | 23.8 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 160 |
| SpringerMaterials Properties | Diamagnetic susceptibility |
| 녹는점 | 57-61 °C |
| 끓는 점 | 125 °C / 15mmHg |
| 밀도 | 1.4980 (rough estimate) |
| 굴절률 | 1.6000 (estimate) |
| 저장 조건 | Store below +30°C. |
| 용해도 | 메탄올에 용해됨 |
| 물리적 상태 | Solid:bulk |
| 색상 | 흰색에서 거의 흰색 |
| 용해도 | 불용성 |
| BRN | 637738 |
| InChI | InChI=1S/C7H3Cl2N/c8-6-2-1-5(4-10)7(9)3-6/h1-3H |
| InChIKey | GRUHREVRSOOQJG-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(Cl)C=C1Cl |
| NIST | 2,4-Dichlorobenzonitrile(6574-98-7) |
화학적 성질
white to almost white crystalline powder
안전 및 규제
| GHS 분류 | WarningH302 (93.8%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Chemical: Benzonitrile, 2,4-dichloro-Status: Active Update: 17-03-2022 https://echa.europa.eu/registration-dossier/-/registered-dossier/20401 |
| Hazard Classes and Categories | Acute Tox. 4 (93.8%) |
| 수질 위해 등급(WGK) | WGK 2 water endangering |
| 운송 번호(UN) | 3276 |
| 관세 코드 | 29269095 |
| 위험 문구(R) | 36/37/38-20/21/22 |
| 위험 표시 | Xn,T,Xi |
| 안전 문구(S) | 36/37/39-26-36-36/37-9 |
| 포장분류 | III |
| 위험 등급 | 6.1Acute Tox. 4 OralEye Irrit. 2 |
| 위험 참고 사항 | Irritant/Toxic |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Used as intermediate for the synthesis of agrochemicals, pharmaceuticals and chemical intermediates.