Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3,5-Dichlorobenzonitrile
3,5-Dichlorobenzonit · 3,5-DICHLOROBENZONITRILE · 3,5-dichlorobenzenenitrile · 3,5-Dichlorobenzonitrile>Benzonitrile, 3,5-dichloro- · 3,5-Dichlorobenzonitrile 97% · 3,5-Dichlorobenzonitrile,97% · 13C6]-3,5-Dichlorobenzonitrile · 3,5-Dichlorobenzenecarbonitrile
식별자 및 물리적 특성
| CAS No. | 6575-00-4 |
|---|---|
| 분자식 | C7H3Cl2N |
| 평균 분자량 | 172.01 g/mol |
| 단동위원소 질량 | 170.96425446 g/mol |
| SMILES | N#Cc1cc(Cl)cc(Cl)c1 |
| InChIKey | PUJSUOGJGIECFQ-UHFFFAOYSA-N |
| PubChem CID | 81052 |
| ChEMBL | CHEMBL51500 |
| EC No. | 229-495-3 |
| DTXSID | DTXSID00215950 |
화학 및 물리적 성질
| XLogP | 2.9 |
|---|---|
| 극성 표면적 | 23.8 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 150 |
| 녹는점 | 64-66 °C (lit.) |
| 끓는 점 | 283.76°C (rough estimate) |
| 밀도 | 1.4980 (rough estimate) |
| 굴절률 | 1.6000 (estimate) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | 에 용해됨클로로포름, 메탄올 (약간 용해됨) |
| 물리적 상태 | 결정성 분말 |
| 색상 | 흰색에서 베이지색 갈색 |
| BRN | 2207019 |
| InChI | InChI=1S/C7H3Cl2N/c8-6-1-5(4-10)2-7(9)3-6/h1-3H |
| InChIKey | PUJSUOGJGIECFQ-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC(Cl)=CC(Cl)=C1 |
| NIST | 3,5-Dichlorobenzonitrile(6575-00-4) |
화학적 성질
white to light yellow crystal powder
안전 및 규제
| GHS 분류 | WarningH302+H312+H332 (14.5%): Harmful if swallowed, in contact with skin or if inhaled [Warning Acute toxicity, oralacute toxicity, dermalacute toxicity, inhalation]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 55 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Status: Active Update: 17-12-2019 https://echa.europa.eu/registration-dossier/-/registered-dossier/30274 |
| Hazard Classes and Categories | Acute Tox. 4 (96.4%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | N |
| 운송 번호(UN) | 3276 |
| 관세 코드 | 29269090 |
| 위험 문구(R) | 20/21/22-36/37/38 |
| 위험 표시 | Xn,T,Xi |
| 안전 문구(S) | 26-37/39-36/37/39-22-36-36/37-9 |
| 포장분류 | III |
| 위험 등급 | 6.1Acute Tox. 4 DermalAcute Tox. 4 InhalationAcute Tox. 4 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 위험 참고 사항 | Irritant/Toxic |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
3,5-Dichlorobenzonitrile was used as internal standard during the programmed temperature vaporization-GC-MS determination of dichlobenil and 2,6-dichlorobenzamide in onions.