Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Dicamba-methyl
60CS16 · Racusa · Racuza · DISUGRAN · RACUZA(R) · Banvel 60CS16 · icamba-methyl · dicamba-methyl
식별자 및 물리적 특성
| CAS No. | 6597-78-0 |
|---|---|
| 분자식 | C9H8Cl2O3 |
| 평균 분자량 | 235.06 g/mol |
| 단동위원소 질량 | 233.9850495 g/mol |
| SMILES | COC(=O)c1c(Cl)ccc(Cl)c1OC |
| InChIKey | AWSBKDYHGOOSML-UHFFFAOYSA-N |
| PubChem CID | 81070 |
| ChEBI | CHEBI:194161 |
| EC No. | 621-351-1 |
| DTXSID | DTXSID1041849 |
화학 및 물리적 성질
| XLogP | 2.5 |
|---|---|
| 극성 표면적 | 35.5 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 210 |
| SpringerMaterials Properties | Fusion temperature |
| 끓는 점 | 335.78°C (rough estimate) |
| 밀도 | 1.3965 (rough estimate) |
| 굴절률 | 1.5000 (estimate) |
| 인화점 | -26 °C |
| 저장 조건 | 2-8°C |
| 용해도 | 클로로포름(약간 용해됨), 메탄올(약간 용해됨) |
| 색상 | 회백색 |
| EPA | Dicamba-methyl (6597-78-0) |
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 7.1% (3 of 42) of reports.WarningH302 (92.9%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 42 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (92.9%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN2810 6.1/PG 3 |
| 관세 코드 | 29189900 |
| 위험 문구(R) | 11-38-48/20-51/53-62-65-67-52/53-36/37/38-22 |
| 위험 표시 | F,Xn,N |
| 안전 문구(S) | 36/37-61-62-26-33-29-16-9 |
용도
용도
Dicamba Methyl Ester is a derivative of Dicamba (D429800), a herbicide that functions by increasing plant growth rate.