Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-클로로-4-니트로벤조일염화물
2-클로로-4-니트로벤조일염화물 · 2-Chlor-4-nitrobenzoylchlorid · 2-CHLORO-4-NITROBENZOYL CHLORIDE · 4-Nitro-2-chlorobenzoyl chloride · Benzoyl chloride, 2-chloro-4-nitro- · 2-Chloro-4-nitrobenzoyl Chloride >
식별자 및 물리적 특성
| CAS No. | 7073-36-1 |
|---|---|
| 분자식 | C7H3Cl2NO3 |
| 평균 분자량 | 220.01 g/mol |
| 단동위원소 질량 | 218.94899832 g/mol |
| SMILES | O=C(Cl)c1ccc([N+](=O)[O-])cc1Cl |
| InChIKey | KTHNITVDTYAHFF-UHFFFAOYSA-N |
| PubChem CID | 81522 |
| EC No. | 230-367-4 |
| DTXSID | DTXSID4064559 |
| 현지명 | 2-클로로-4-니트로벤조일염화물 |
화학 및 물리적 성질
| XLogP | 3 |
|---|---|
| 극성 표면적 | 62.9 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 228 |
| 녹는점 | 26°C |
| 끓는 점 | 165°C 20mm |
| 밀도 | 1.575±0.06 g/cm3(Predicted) |
| 굴절률 | 1.5950 |
| 인화점 | 165°C/20mm |
| 저장 조건 | RT, stored under nitrogen |
| 용해도 | 톨루엔에 용해됨 |
| 물리적 상태 | powder to lump to clear liquid |
| 색상 | White or Colorless to Yellow to Green |
| BRN | 519794 |
| EPA | Benzoyl chloride, 2-chloro-4-nitro- (7073-36-1) |
안전 및 규제
| GHS 분류 | DangerH290 (12.5%): May be corrosive to metals [Warning Corrosive to Metals]P234, P260, P264, P264+P265, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P317, P321, P363, P390, P405, P406, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 8 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Met. Corr. 1 (12.5%) |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | 3265 |
| 관세 코드 | 2916.39.7900 |
| 위험 문구(R) | 34-41 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36/37/39-45-39 |
| 포장분류 | II |
| 위험 등급 | 8 |
용도
용도
2-Chloro-4-nitro-benzoyl chloride is a reactant in the synthesis of benzoxazole derivatives as interleukin-6 antagonists.