Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
7-메틸-8-니트로퀴놀린
7-메틸-8-니트로퀴놀린 · 7-METHYL-8-NITROQUINOLINE · Quinoline, 7-methyl-8-nitro- · 7-Methyl-8-nitroquinoline>7-Methyl-8-nitroquinoline,98+% · 7-METHYL-8-NITROQUINOLINE 7471-63-8
식별자 및 물리적 특성
| CAS No. | 7471-63-8 |
|---|---|
| 분자식 | C10H8N2O2 |
| 평균 분자량 | 188.18 g/mol |
| 단동위원소 질량 | 188.0585775 g/mol |
| SMILES | Cc1ccc2cccnc2c1[N+](=O)[O-] |
| InChIKey | ZZDTVYJYMRSNQL-UHFFFAOYSA-N |
| PubChem CID | 81981 |
| ChEMBL | CHEMBL1668960 |
| EC No. | 231-268-9 |
| DTXSID | DTXSID80225693 |
| 현지명 | 7-메틸-8-니트로퀴놀린 |
화학 및 물리적 성질
| XLogP | 2.4 |
|---|---|
| 극성 표면적 | 58.7 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 227 |
| Kovats Retention Index | 1798.9305.75 |
| 녹는점 | 185-186°C |
| 끓는 점 | 330.5±27.0 °C(Predicted) |
| 밀도 | 1.298±0.06 g/cm3(Predicted) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | 클로르포름, 메탄올(약간 용해됨) |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 1.71±0.31(Predicted) |
| 색상 | 황백색에서 연한 노란색 |
| 용해도 | 물에 불용성. |
| BRN | 154601 |
안전 및 규제
| GHS 분류 | WarningH315 (20%): Causes skin irritation [Warning Skin corrosion/irritation]H319 (20%): Causes serious eye irritation [Warning Serious eye damage/eye irritation]H341 (80%): Suspected of causing genetic defects [Warning Germ cell mutagenicity]P203, P264, P264+P265, P280, P302+P352, P305+P351+P338, P318, P321, P332+P317, P337+P317, P362+P364, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 5 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies.Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. For more detailed information, please visit ECHA C&L website. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (20%)Eye Irrit. 2 (20%) |
| 관세 코드 | 2933499090 |
| 위험 문구(R) | 68 |
| 안전 문구(S) | 22-36/37 |
용도
용도
7-Methyl-8-nitroquinoline is used as a pharmaceutical intermediate.