Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-Chloro-5-hydroxypyridine
6-CHLOROPYRIDIN-3-OL · 2-Chloro-5-Pyridol · 2-CHLORO-5-PYRIDINOL · 6-Chloro-3-pyridinol · 2-Chloropyridin-5-ol · 6-chloropyridine-3-ol · 3-PYRIDINOL, 6-CHLORO- · 2-Chloro-5-hydropyridine
식별자 및 물리적 특성
| CAS No. | 41288-96-4 |
|---|---|
| 분자식 | C5H4ClNO |
| 평균 분자량 | 129.54 g/mol |
| 단동위원소 질량 | 128.99814143 g/mol |
| SMILES | Oc1ccc(Cl)nc1 |
| InChIKey | KVCOOWROABTXDJ-UHFFFAOYSA-N |
| PubChem CID | 819821 |
| ChEMBL | CHEMBL3236918 |
| EC No. | 670-289-1 |
| DTXSID | DTXSID50356120 |
화학 및 물리적 성질
| XLogP | 1.4 |
|---|---|
| 극성 표면적 | 33.1 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 8 |
| 형식 전하 | 0 |
| 복잡도 | 78.8 |
| 녹는점 | 155-158°C |
| 끓는 점 | 351.9±22.0 °C(Predicted) |
| 밀도 | 1.392±0.06 g/cm3(Predicted) |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 물리적 상태 | powder to crystal |
| pKa(산도 계수) | 8.69±0.10(Predicted) |
| 색상 | 밝은 노란색에서 갈색까지 |
| InChI | InChI=1S/C5H4ClNO/c6-5-2-1-4(8)3-7-5/h1-3,8H |
| InChIKey | KVCOOWROABTXDJ-UHFFFAOYSA-N |
| SMILES | C1=NC(Cl)=CC=C1O |
화학적 성질
Light yellow Cryst
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 11 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 관세 코드 | 29333990 |
| 위험 문구(R) | 36/37/38-22 |
| 위험 표시 | T,Xi,Xn |
| 안전 문구(S) | 26-36/37/39-36-37 |
| 포장분류 | III |
| 위험 등급 | IRRITANT |