Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-Bromohexadecanoic acid
2-bromopalmitate · 2-BROMOPALMITIC ACID · Hexadecanoic acid, 2-bromo- · A-BROMOPALMITIC ACID · ALPHA-BROMOPALMITATE · α-Bromopalmitic acid · Bromohexadecanoicacid · 2-bromo-hexadecanoicaci
식별자 및 물리적 특성
| CAS No. | 18263-25-7 |
|---|---|
| 분자식 | C16H31BrO2 |
| 평균 분자량 | 335.32 g/mol |
| 단동위원소 질량 | 334.15074233 g/mol |
| SMILES | CCCCCCCCCCCCCCC(Br)C(=O)O |
| InChIKey | DPRAYRYQQAXQPE-UHFFFAOYSA-N |
| PubChem CID | 82145 |
| ChEMBL | CHEMBL118417 |
| ChEBI | CHEBI:133152 |
| EC No. | 242-137-0 |
| DTXSID | DTXSID0037734 |
화학 및 물리적 성질
| XLogP | 7.8 |
|---|---|
| 극성 표면적 | 37.3 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 14 |
| 무거운 원자 수 | 19 |
| 형식 전하 | 0 |
| 복잡도 | 207 |
| 지질 | Fatty Acyls [FA] -> Fatty Acids and Conjugates [FA01] -> Halogenated fatty acids [FA0109] |
| 녹는점 | 52-54 °C |
| 끓는 점 | 403.4±18.0 °C(Predicted) |
| 밀도 | 1.1985 (rough estimate) |
| 굴절률 | 1.4650 (estimate) |
| 인화점 | 113 °C |
| 저장 조건 | RT |
| 용해도 | 메탄올: 용해성1g/10mL, 투명, 무색 |
| pKa(산도 계수) | 2.97±0.21(Predicted) |
| 물리적 상태 | 고체 |
| 색상 | 하얀색 |
| BRN | 1726517 |
| 안정성 | 제공된 대로 구매일로부터 1년 동안 안정적입니다. DMSO 또는 에탄올 용액은 -20°C에서 최대 2개월 동안 보관할 수 있습니다. |
| InChI | InChI=1S/C16H31BrO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(17)16(18)19/h15H,2-14H2,1H3,(H,18,19) |
| InChIKey | DPRAYRYQQAXQPE-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(Br)CCCCCCCCCCCCCC |
| EPA | Hexadecanoic acid, 2-bromo- (18263-25-7) |
화학적 성질
WHITE CRYSTALLINE POWDER
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 41 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Status: Active Update: 26-03-2019 https://echa.europa.eu/registration-dossier/-/registered-dossier/27999 |
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 관세 코드 | 2915907098 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36 |
| 저장 분류 | 11 - Combustible Solids |
용도
일반 설명
PPARδ (peroxisome proliferator-activated receptor, delta isoform) acts as a transcription factor for gene expression as well as playing a role in lipid metabolism regulation; activity of this receptor is ligand-regulated. 2-Bromohexadecanoic acid is a metabolically stable analoge of the fatty acid palmitic acid that has been shown to be a natural ligand for the PPARδ receptor. 2-Bromohexadecanoic acid has also been used in studies of fatty acid oxidation, palmitoylation, and glucose uptake.